CAS 206559-60-6
:(4-methoxy-2,3-dimethylphenyl)acetonitrile
Description:
(4-Methoxy-2,3-dimethylphenyl)acetonitrile, with the CAS number 206559-60-6, is an organic compound characterized by its aromatic structure and functional groups. It features a phenyl ring substituted with a methoxy group and two methyl groups, contributing to its unique chemical properties. The presence of the acetonitrile functional group (-C≡N) indicates that it contains a cyano group, which is known for its reactivity and ability to participate in various chemical reactions, such as nucleophilic additions. This compound is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its molecular structure suggests moderate polarity, which can influence its solubility in organic solvents. Additionally, the methoxy group can enhance the compound's electron-donating properties, potentially affecting its reactivity and interactions with other molecules. Overall, (4-methoxy-2,3-dimethylphenyl)acetonitrile is of interest in synthetic organic chemistry and may have applications in pharmaceuticals or agrochemicals.
Formula:C11H13NO
InChI:InChI=1/C11H13NO/c1-8-9(2)11(13-3)5-4-10(8)6-7-12/h4-5H,6H2,1-3H3
SMILES:Cc1c(C)c(ccc1CC#N)OC
Synonyms:- Benzeneacetonitrile, 4-Methoxy-2,3-Dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2,3-Dimethyl-4-methoxyphenylacetonitrile
CAS:2,3-Dimethyl-4-methoxyphenylacetonitrile
Molecular weight:175.22702g/mol


