CAS 206559-61-7
:7-Ethoxybenzofuran-2-carboxylic acid
Description:
7-Ethoxybenzofuran-2-carboxylic acid is a chemical compound characterized by its unique structure, which includes a benzofuran moiety and an ethoxy group. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities, such as moderate solubility in organic solvents and potential reactivity due to the presence of the carboxylic acid group. The ethoxy substituent can influence its polarity and solubility in various solvents. As a benzofuran derivative, it may also exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. The compound's CAS number, 206559-61-7, allows for easy identification in chemical databases and literature. Its synthesis and applications may be explored in various fields, including organic synthesis and drug development, although specific applications would depend on further research into its biological properties and reactivity. Overall, 7-Ethoxybenzofuran-2-carboxylic acid represents a versatile structure with potential utility in various chemical contexts.
Formula:C11H9O4
InChI:InChI=1/C11H10O4/c1-2-14-8-5-3-4-7-6-9(11(12)13)15-10(7)8/h3-6H,2H2,1H3,(H,12,13)/p-1
SMILES:CCOc1cccc2cc(C(=O)[O-])oc12
Synonyms:- 7-Ethoxy-1-Benzofuran-2-Carboxylic Acid
- 7-Ethoxy-1-Benzofuran-2-Carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
7-Ethoxybenzofuran-2-carboxylic acid
CAS:Formula:C11H10O4Color and Shape:SolidMolecular weight:206.19477-Ethoxybenzofuran-2-carboxylic acid
CAS:7-Ethoxybenzofuran-2-carboxylic acid
Molecular weight:206.1947g/mol7-Ethoxybenzofuran-2-carboxylic acid
CAS:Formula:C11H10O4Purity:95.0%Color and Shape:SolidMolecular weight:206.1977-Ethoxybenzofuran-2-carboxylic acid
CAS:7-Ethoxybenzofuran-2-carboxylic acid is an experimental compound that has been shown to be a senescence inducer in fruit. It has been found to have increased the production of 2,4-dichlorophenoxyacetic acid and other phytohormones in fruit cells. 7-Ethoxybenzofuran-2-carboxylic acid may be a useful surrogate for the detection of postharvest diseases and disorders in fruit.
Formula:C11H10O4Purity:Min. 95%Molecular weight:206.19 g/mol




