CAS 206559-62-8
:2-ethoxy-6-[(E)-2-nitroethenyl]phenol
Description:
2-Ethoxy-6-[(E)-2-nitroethenyl]phenol, with the CAS number 206559-62-8, is an organic compound characterized by its phenolic structure, which includes an ethoxy group and a nitroethenyl substituent. This compound features a phenol ring that is substituted at the 2-position with an ethoxy group and at the 6-position with a (E)-2-nitroethenyl group, contributing to its unique chemical properties. The presence of the nitro group introduces significant polarity and can influence the compound's reactivity, making it potentially useful in various chemical reactions, including those involving electrophilic substitution. The ethoxy group enhances solubility in organic solvents, while the phenolic hydroxyl group can participate in hydrogen bonding, affecting the compound's physical properties such as melting and boiling points. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical applications. Overall, 2-ethoxy-6-[(E)-2-nitroethenyl]phenol is a complex molecule with potential utility in both synthetic and medicinal chemistry.
Formula:C10H11NO4
InChI:InChI=1/C10H11NO4/c1-2-15-9-5-3-4-8(10(9)12)6-7-11(13)14/h3-7,12H,2H2,1H3/b7-6+
Synonyms:- 2-Ethoxy-6-[(E)-2-nitrovinyl]phenol
- Phenol, 2-ethoxy-6-[(E)-2-nitroethenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3-Ethoxy-2-hydroxy-β-nitrostyrene
CAS:3-Ethoxy-2-hydroxy-β-nitrostyrene
Molecular weight:209.19864g/mol


