CAS 20662-89-9
:4-phenyl-1,3-oxazole
Description:
4-Phenyl-1,3-oxazole is an organic compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. The presence of a phenyl group at the 4-position of the oxazole ring contributes to its aromatic properties and can influence its reactivity and solubility. This compound typically exhibits a white to light yellow crystalline appearance and is known for its potential applications in organic synthesis and as a building block in the development of pharmaceuticals and agrochemicals. 4-Phenyl-1,3-oxazole may also display interesting photophysical properties, making it a candidate for use in fluorescent materials or sensors. Its chemical behavior is influenced by the electron-withdrawing nature of the oxazole ring, which can affect its reactivity in various chemical reactions, including electrophilic substitutions and nucleophilic attacks. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H7NO
InChI:InChI=1/C9H7NO/c1-2-4-8(5-3-1)9-6-11-7-10-9/h1-7H
SMILES:c1ccc(cc1)c1cocn1
Synonyms:- 4-Phenyloxazole
- Oxazole, 4-phenyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Phenyloxazole
CAS:4-Phenyloxazole is the name given to a series of compounds that are isomers. These compounds are benzonitriles, which have two aromatic rings and one nitrile group. They can be protonated with ammonium formate to give the corresponding amide. The reaction time for this transformation is 5 minutes at room temperature. 4-Phenyloxazole has been shown to bind to cannabinoid receptors and act as an agonist, resulting in the release of dopamine in mice brains. It also has been shown to have analgesic effects and be an active natural product against cancer cells. This compound exists as two enantiomers: R and S. The chemical properties of these two isomers differ slightly, with the R form being more potent than the S form.Formula:C9H7NOPurity:Min. 95%Molecular weight:145.16 g/mol



