CAS 206646-04-0
:[(1R)-2-(6-aminopurin-9-yl)-1-methyl-ethoxy]methyl-phosphonooxy-phosphinic acid
Description:
The chemical substance known as [(1R)-2-(6-aminopurin-9-yl)-1-methyl-ethoxy]methyl-phosphonooxy-phosphinic acid, with the CAS number 206646-04-0, is a phosphonic acid derivative that exhibits significant biological activity, particularly in the context of antiviral properties. This compound features a purine base structure, which is characteristic of nucleobases, and is modified with a phosphonic acid moiety that enhances its stability and bioactivity. The presence of the amino group contributes to its potential interactions with biological targets, making it relevant in medicinal chemistry. Its unique structure allows it to mimic natural nucleotides, which can interfere with nucleic acid synthesis in pathogens. The compound is typically studied for its potential applications in antiviral therapies, particularly against viruses that rely on nucleic acid replication. Additionally, its physicochemical properties, such as solubility and stability, are crucial for its efficacy in biological systems. Overall, this substance represents a significant area of research in the development of antiviral agents.
Formula:C9H15N5O7P2
InChI:InChI=1/C9H15N5O7P2/c1-6(20-5-22(15,16)21-23(17,18)19)2-14-4-13-7-8(10)11-3-12-9(7)14/h3-4,6H,2,5H2,1H3,(H,15,16)(H2,10,11,12)(H2,17,18,19)/t6-/m1/s1
SMILES:C[C@H](Cn1cnc2c(N)ncnc12)OCP(=O)(O)OP(=O)(O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Isohypophosphoric acid, P'-[[(1R)-2-(6-amino-9H-purin-9-yl)-1-methylethoxy]methyl]-
CAS:Formula:C9H15N5O7P2Molecular weight:367.1922Tenofovir Phosphate Diammonia Salt, >90%
CAS:Controlled ProductApplications Tenofovir Phosphate Diammonia Salt is a metabolite of Tenofovir (T018500), an acyclic phosphonate nucleotide analogue; reverse transcriptase inhibitor. Used as an anti-HIV agent. Antiviral.
References Michelson, A.M., et al.: Biochim. Biophys. Acta, 91, 1 (1964); Rosenberg, I., et al.: Collect. Czeck. Chem. Commun., 50, 1507 (1985); Shaw, J.-P., et al.: Pharm. Res., 14, 1824 (1997); Wyles, D., et al.: Clin Infect. Dis., 40, 174 (2005),; Peng, J., et al.: J. Clin. Pharmacol., 46, 265 (2006); Seminari, E., et al.: J. Antimicrob. Chemother., 60, 831 (2007)Formula:C9H21N7O7P2Purity:>90%Color and Shape:NeatMolecular weight:401.25Tenofovir Phosphate Diammonia Salt-13C5
CAS:Controlled ProductFormula:C4C5H15N5O7P2•2(NH3)Color and Shape:NeatMolecular weight:384.07122



