CAS 206648-13-7

[(1S)-1-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]ethyl]phosphonic acid hydrochloride

Description:

The chemical substance known as [(1S)-1-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]ethyl]phosphonic acid hydrochloride, with the CAS number 206648-13-7, is a phosphonic acid derivative characterized by its complex structure, which includes a quinoxaline moiety. This compound typically exhibits properties associated with both phosphonic acids and heterocyclic compounds, including potential biological activity. It is likely to be soluble in polar solvents due to the presence of the phosphonic acid functional group, which can engage in hydrogen bonding. The bromine substituent may influence its reactivity and biological interactions. As a hydrochloride salt, it is expected to be stable under standard conditions but may require careful handling due to its potential biological effects. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its synthesis and characterization would involve standard organic chemistry techniques, including purification methods suitable for complex organic molecules.

Formula: C₁₁H₁₄BrClN₃O₅P

InChI: InChI=1/C11H13BrN3O5P.ClH/c1-5(21(18,19)20)13-4-6-2-7(12)3-8-9(6)15-11(17)10(16)14-8;/h2-3,5,13H,4H2,1H3,(H,14,16)(H,15,17)(H2,18,19,20);1H/t5-;/m0./s1

SMILES: C[C@@H](NCc1cc(cc2c1[nH]c(=O)c(=O)[nH]2)Br)P(=O)(O)O.Cl

CGP 78608

Controlled Product

CAS: 206648-13-7

Formula: C₁₁H₁₃BrN₃O₅P

Color and Shape: Neat

Molecular weight: 378.116

Ref: TR-C583563

CGP 78608

CAS: 206648-13-7

CGP 78608 is a neuropeptide Y (NPY) Y5 receptor antagonist, which is a synthetic compound derived from a complex series of chemical syntheses. The source of this product lies in tailored organic chemistry processes designed to precisely inhibit specific receptor subtypes associated with neuropeptide Y.

Formula: C₁₁H₁₃BrN₃O₅P

Purity: Min. 95%

Molecular weight: 378.12 g/mol

Ref: 3D-BC183635

CGP-78608

CAS: 206648-13-7

CGP-78608 is a glycine site-specific N-methyl-D-aspartate receptor antagonist prevents activation of the NMDA/NO/CGMP pathway by ammonia.

Formula: C₁₁H₁₃BrN₃O₅P

Color and Shape: Solid

Molecular weight: 378.12

Ref: TM-T69949