
CAS 206658-92-6
:1,2,3,4-Tetrahydro-9-acridinamine hydrochloride hydrate (1:?:?)
Description:
1,2,3,4-Tetrahydro-9-acridinamine hydrochloride hydrate is a chemical compound characterized by its unique structure, which includes a tetrahydroacridine moiety. This compound is typically a white to off-white solid that is soluble in water and various organic solvents, making it useful in pharmaceutical applications. The hydrochloride form indicates that it is a salt, which often enhances its stability and solubility. The presence of the amine group suggests potential basic properties, allowing it to participate in various chemical reactions, including those involving protonation. This compound may exhibit biological activity, which is of interest in medicinal chemistry, particularly in the development of drugs targeting neurological or psychiatric disorders. Its specific interactions and mechanisms of action would require further investigation through experimental studies. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity or reactivity.
Formula:C13H14N2·xClH·xH2O
InChI:InChI=1S/C13H14N2.ClH.H2O/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;;/h1,3,5,7H,2,4,6,8H2,(H2,14,15);1H;1H2
InChI key:InChIKey=PXGRMZYJAOQPNZ-UHFFFAOYSA-N
SMILES:NC1=C2C(=NC=3C1=CC=CC3)CCCC2.Cl.O
Synonyms:- 9-Acridinamine, 1,2,3,4-tetrahydro-, hydrochloride, hydrate (1:?:?)
- 9-Acridinamine, 1,2,3,4-tetrahydro-, hydrochloride, hydrate
- 1,2,3,4-Tetrahydro-9-acridinamine hydrochloride hydrate (1:?:?)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
9-Acridinamine, 1,2,3,4-tetrahydro-, hydrochloride, hydrate
CAS:Formula:C13H17ClN2OPurity:%Color and Shape:SolidMolecular weight:252.73999-Amino-1,2,3,4-tetrahydroacridine hydrochloride hydrate
CAS:Formula:C13H14N2·HCl·xH2OMolecular weight:234.72 (anhydrous)9-Amino-1,2,3,4-tetrahydroacridine hydrochloride hydrate
CAS:9-Amino-1,2,3,4-tetrahydroacridine hydrochloride hydrate
Formula:C13H14N2·ClH·H2OPurity:97%Color and Shape: faint yellow powderMolecular weight:252.74g/molTacrine hydrochloride (hydrate)
CAS:Tacrine hydrochloride hydrate (Tetrahydroaminacrine) is a cholinesterase inhibitor that crosses the blood-brain barrier.Formula:C13H14N2·XHCl·XH2OPurity:99.01% - 99.89%Color and Shape:SolidMolecular weight:234.729-Amino-1,2,3,4-tetrahydroacridine hydrochloride hydrate
CAS:Purity:97.0%Color and Shape:SolidMolecular weight:252.740005493164069-Amino-1,2,3,4-tetrahydroacridine HCl hydrate
CAS:Controlled Product9-Amino-1,2,3,4-tetrahydroacridine HCl hydrate (9AHT) is a cholinergic agent that inhibits the activity of the ns3 protease. It has been shown to inhibit tumor growth and induce apoptosis in prostate cancer cells. 9AHT also exhibits neuroprotective effects through its ability to inhibit acetylcholinesterase and reduce neuronal death. This drug has been used as a biological sample for the detection of amyloid proteins in cell culture. Acetate extract from Astragalus (a medicinal plant) was found to have an inhibitory effect on acetylcholinesterase activity. Protocatechuic acid, which is found in many plants, including grapefruit peel, has also been shown to be an inhibitor of acetylcholinesterase activity.Formula:C13H15ClN2·xH2OPurity:Min. 95%Color and Shape:White PowderMolecular weight:234.72 g/mol






