CAS 2067-84-7
:1,4-Dihydropyrido[2,3-b]pyrazine-2,3-dione
Description:
1,4-Dihydropyrido[2,3-b]pyrazine-2,3-dione, with the CAS number 2067-84-7, is a heterocyclic organic compound characterized by its fused pyridine and pyrazine rings. This compound typically exhibits a bicyclic structure, which contributes to its unique chemical properties. It is known for its potential biological activity, including antimicrobial and antitumor properties, making it of interest in pharmaceutical research. The presence of carbonyl groups in the structure enhances its reactivity, allowing for various chemical modifications. In terms of solubility, it may exhibit moderate solubility in polar solvents, which is common for compounds with similar structures. The compound's stability can be influenced by environmental factors such as pH and temperature. Overall, 1,4-Dihydropyrido[2,3-b]pyrazine-2,3-dione is a valuable compound in medicinal chemistry, with ongoing research exploring its applications and mechanisms of action.
Formula:C7H5N3O2
InChI:InChI=1S/C7H5N3O2/c11-6-7(12)10-5-4(9-6)2-1-3-8-5/h1-3H,(H,9,11)(H,8,10,12)
InChI key:InChIKey=ZTCJWOFMAWQWRD-UHFFFAOYSA-N
SMILES:O=C1NC=2C(NC1=O)=NC=CC2
Synonyms:- 2,3-Dihydroxy-1,4,5-triazanaphthalene
- 2,3-Dihydroxypyrido[2,3-b]pyrazine
- Nsc 91561
- Pyrido(2,3-b)pyrazine-2,3-diol
- Pyrido(2,3-b)pyrazine-2,3-dione, 1,4-dihydro- (8CI)(9CI)
- Pyrido[2,3-b]pyrazine-2,3-dione, 1,4-dihydro-
- 1,4-Dihydropyrido(2,3-b)pyrazine-2,3-dione
- 1,4-Dihydropyrido[2,3-b]pyrazine-2,3-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
