CAS 206761-77-5

N-[(4-methylphenyl)sulfonyl]hydrazinecarboxamide hydrochloride

Description:

N-[(4-methylphenyl)sulfonyl]hydrazinecarboxamide hydrochloride, with the CAS number 206761-77-5, is a chemical compound characterized by its sulfonamide functional group, which contributes to its potential biological activity. This compound features a hydrazinecarboxamide structure, indicating the presence of a hydrazine moiety linked to a carboxamide, which can influence its reactivity and solubility. The presence of the 4-methylphenyl group suggests that it may exhibit aromatic characteristics, potentially affecting its interactions with biological targets. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its applicability in various chemical and pharmaceutical contexts. The compound may be of interest in medicinal chemistry, particularly for its potential use in drug development, given the biological significance of sulfonamides and hydrazines. However, specific biological activities, toxicity, and pharmacokinetic properties would require further investigation through empirical studies.

Formula: C₈H₁₂ClN₃O₃S

InChI: InChI=1/C8H11N3O3S.ClH/c1-6-2-4-7(5-3-6)15(13,14)11-8(12)10-9;/h2-5H,9H2,1H3,(H2,10,11,12);1H

SMILES: Cc1ccc(cc1)S(=O)(=O)NC(=NN)O.Cl

Synonyms:

• Hydrazinecarboxamide, N-[(4-methylphenyl)sulfonyl]-, hydrochloride (1:1)
• N-[(4-Methylphenyl)sulfonyl]hydrazinecarboxamide hydrochloride (1:1)

N-Tosylhydrazinecarboxamide hydrochloride

CAS: 206761-77-5

Formula: C₈H₁₂ClN₃O₃S

Molecular weight: 265.7172

Ref: IN-DA002INA

4-(4-Methylphenylsulfonyl)semicarbazide hydrochloride

CAS: 206761-77-5

4-(4-Methylphenylsulfonyl)semicarbazide hydrochloride

Molecular weight: 265.71718g/mol

Ref: 54-OR1021599

4-(4-Methyphenylsulfonyl)-semicarbazidehydrochloride

CAS: 206761-77-5

Formula: C₈H₁₂ClN₃O₃S

Purity: 98%

Color and Shape: Solid

Molecular weight: 265.71

Ref: 10-F018859