CAS 206761-80-0
:(2S,3S)-2,3-Dihydroxy-4-[(4-nitrophenyl)amino]-4-oxobutanoic acid
Description:
(2S,3S)-2,3-Dihydroxy-4-[(4-nitrophenyl)amino]-4-oxobutanoic acid is a chemical compound characterized by its specific stereochemistry and functional groups. It features two hydroxyl (-OH) groups located at the second and third carbon atoms of a butanoic acid backbone, which contributes to its solubility and reactivity. The presence of a 4-nitrophenylamino group indicates that it has an aromatic ring with a nitro substituent, which can influence its electronic properties and potential biological activity. This compound is likely to exhibit both acidic and basic characteristics due to the carboxylic acid group and the amino group, respectively. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the modifications can enhance binding affinity to biological targets. Additionally, the compound's stereochemistry may play a crucial role in its interaction with enzymes or receptors, making it an interesting subject for further research in drug design and development.
Formula:C10H10N2O7
InChI:InChI=1S/C10H10N2O7/c13-7(8(14)10(16)17)9(15)11-5-1-3-6(4-2-5)12(18)19/h1-4,7-8,13-14H,(H,11,15)(H,16,17)/t7-,8-/m0/s1
InChI key:InChIKey=UEJFXRDWAWAUFQ-YUMQZZPRSA-N
SMILES:N(C([C@H]([C@@H](C(O)=O)O)O)=O)C1=CC=C(N(=O)=O)C=C1
Synonyms:- Butanoic acid, 2,3-dihydroxy-4-[(4-nitrophenyl)amino]-4-oxo-, (2S,3S)-
- Butanoic acid, 2,3-dihydroxy-4-[(4-nitrophenyl)amino]-4-oxo-, [S-(R*,R*)]-
- (2S,3S)-2,3-Dihydroxy-4-[(4-nitrophenyl)amino]-4-oxobutanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

