CAS 206762-46-1
:N-(3,4,5-trimethoxyphenyl)hydrazinecarbothioamide
Description:
N-(3,4,5-trimethoxyphenyl)hydrazinecarbothioamide is a chemical compound characterized by its hydrazine and thioamide functional groups. It features a phenyl ring substituted with three methoxy groups at the 3, 4, and 5 positions, which enhances its solubility and reactivity. The presence of the hydrazine moiety suggests potential applications in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals. The thioamide group contributes to its reactivity, making it a candidate for various chemical transformations. This compound may exhibit biological activity, potentially influencing enzyme interactions or serving as a precursor in the synthesis of more complex molecules. Its structural features suggest that it could participate in hydrogen bonding and other intermolecular interactions, which may affect its physical properties such as melting point, boiling point, and solubility in different solvents. Overall, N-(3,4,5-trimethoxyphenyl)hydrazinecarbothioamide is a versatile compound with potential applications in various fields of chemistry and biochemistry.
Formula:C10H15N3O3S
InChI:InChI=1/C10H15N3O3S/c1-14-7-4-6(12-10(17)13-11)5-8(15-2)9(7)16-3/h4-5H,11H2,1-3H3,(H2,12,13,17)
SMILES:COc1cc(cc(c1OC)OC)N=C(NN)S
Synonyms:- Hydrazinecarbothioamide, N-(3,4,5-trimethoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
