CAS 20680-48-2
:1,2-Naphthoquinone-2-diazide-4-sulfonic acid
Description:
1,2-Naphthoquinone-2-diazide-4-sulfonic acid, with the CAS number 20680-48-2, is a chemical compound that belongs to the class of naphthoquinone derivatives. It is characterized by its sulfonic acid functional group, which enhances its solubility in water and makes it useful in various applications. This compound is typically used in the field of photochemistry and as a photosensitive material in the production of photoresists for microelectronics and printing processes. Its structure includes a naphthalene ring system, which contributes to its stability and reactivity. The presence of the diazide group allows for the formation of reactive intermediates upon exposure to light, facilitating cross-linking or polymerization reactions. Additionally, 1,2-Naphthoquinone-2-diazide-4-sulfonic acid exhibits properties that make it suitable for use in dye-sensitized solar cells and other photonic applications. Safety precautions should be observed when handling this compound, as it may pose health risks upon exposure.
Formula:C10H6N2O4S
InChI:InChI=1S/C10H6N2O4S/c11-12-8-5-9(17(14,15)16)6-3-1-2-4-7(6)10(8)13/h1-5H,(H,14,15,16)
InChI key:InChIKey=WUCDFJQVKORCRA-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C=1C=2C(C(=O)C(=[N+]=[N-])C1)=CC=CC2
Synonyms:- TKF 428
- 1,2-Naphthoquinone-2-diazide-4-sulfonic acid
- 3-Diazo-3,4-dihydro-4-oxo-1-naphthalenesulfonic acid
- 1-Naphthalenesulfonic acid, 3-diazo-3,4-dihydro-4-oxo-
- 2-Diazo-1-naphthalenone-4-sulfonic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
