CAS 20686-66-2: 2-Methylnaphtho(2,3,d)oxazole
Description:2-Methylnaphtho(2,3-d)oxazole, with the CAS number 20686-66-2, is an organic compound characterized by its fused naphthalene and oxazole structures. This compound features a methyl group attached to the naphthalene ring, which influences its chemical properties and reactivity. Typically, compounds of this class exhibit fluorescence, making them of interest in various applications, including organic electronics and photonic devices. The presence of the oxazole ring contributes to its potential as a heterocyclic compound, which can participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks. Additionally, 2-Methylnaphtho(2,3-d)oxazole may exhibit biological activity, which could be explored for pharmaceutical applications. Its solubility, stability, and interaction with other substances can vary based on environmental conditions such as pH and temperature. Overall, this compound represents a unique intersection of aromatic chemistry and heterocyclic chemistry, with potential applications in materials science and medicinal chemistry.
Formula:C12H9NO
InChI:InChI=1S/C12H9NO/c1-8-13-11-6-9-4-2-3-5-10(9)7-12(11)14-8/h2-7H,1H3
InChI key:InChIKey=WMIHEWJRNFUVNR-UHFFFAOYSA-N
SMILES:N=1C=2C=C3C=CC=CC3=CC2OC1C
- Synonyms:
- 2-Methylbenzo[f][1,3]benzoxazole
- 2-Methylnaphth(2,3-d)oxazole
- 2-Methylnaphtho[2,3-D][1,3]Oxazole
- Naphth[2,3-d]oxazole, 2-methyl-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Naphth[2,3-d]oxazole, 2-methyl- REF: IN-DA002IPMCAS: 20686-66-2 | 97.0% | 82.00 €~248.00 € | Wed 16 Apr 25 |
![]() | 2-Methylnaphth[2,3-D]Oxazole REF: 54-OR1029483CAS: 20686-66-2 | 98% | 32.00 €~2,636.00 € | Thu 17 Apr 25 |
![]() | 2-Methylnaphth[2,3-d]oxazole REF: 10-F047080CAS: 20686-66-2 | 97.0% | - - - | Discontinued product |
![]() | 2-Methylnaphth[2,3-d]oxazole REF: 3D-FM75383CAS: 20686-66-2 | Min. 95% | - - - | Discontinued product |

Naphth[2,3-d]oxazole, 2-methyl-
Ref: IN-DA002IPM
1g | 82.00 € |

Ref: 54-OR1029483
1g | 71.00 € | ||
5g | 280.00 € | ||
25g | 731.00 € | ||
100g | 2,636.00 € | ||
250mg | 32.00 € |

2-Methylnaphth[2,3-d]oxazole
Ref: 10-F047080
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
25g | Discontinued | Request information |

2-Methylnaphth[2,3-d]oxazole
Ref: 3D-FM75383
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information |