CAS 206860-48-2
:4-fluoro-2-(trifluoromethyl)benzyl bromide
Description:
4-Fluoro-2-(trifluoromethyl)benzyl bromide is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a fluorine atom and a trifluoromethyl group. The presence of the bromine atom in the benzyl position enhances its reactivity, making it a useful intermediate in various chemical syntheses, particularly in the development of pharmaceuticals and agrochemicals. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It exhibits significant polarity due to the electronegative fluorine and bromine substituents, which can influence its solubility in organic solvents. Additionally, the trifluoromethyl group contributes to its unique electronic properties, often enhancing lipophilicity and biological activity. Safety considerations are important when handling this compound, as it may pose health risks, including irritation or toxicity. Proper storage and handling protocols should be followed to mitigate any hazards associated with its use.
Formula:C8H5BrF4
InChI:InChI=1/C8H5BrF4/c9-4-5-1-2-6(10)3-7(5)8(11,12)13/h1-3H,4H2
SMILES:c1cc(cc(c1CBr)C(F)(F)F)F
Synonyms:- 1-(Bromomethyl)-4-Fluoro-2-(Trifluoromethyl)Benzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzene, 1-(bromomethyl)-4-fluoro-2-(trifluoromethyl)-
CAS:Formula:C8H5BrF4Purity:98%Color and Shape:LiquidMolecular weight:257.02294-Fluoro-2-(trifluoromethyl)benzyl Bromide
CAS:Formula:C8H5BrF4Purity:>97.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:257.034-Fluoro-2-(trifluoromethyl)benzyl bromide
CAS:4-Fluoro-2-(trifluoromethyl)benzyl bromideFormula:C8H5BrF4Purity:98%Color and Shape: faint yellow liquidMolecular weight:257.02g/mol4-Fluoro-2-(trifluoromethyl)benzyl bromide
CAS:Formula:C8H5BrF4Purity:≥98%Color and Shape:Liquid, ClearMolecular weight:257.0264-Fluoro-2-(trifluoromethyl)benzyl bromide
CAS:Please enquire for more information about 4-Fluoro-2-(trifluoromethyl)benzyl bromide including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C8H5BrF4Purity:Min. 95%Molecular weight:257.02 g/mol




