CAS 20689-03-6
:Phenylmethyl 2,3-O-(1-methylethylidene)-α-D-mannofuranoside
Description:
Phenylmethyl 2,3-O-(1-methylethylidene)-α-D-mannofuranoside, with the CAS number 20689-03-6, is a glycoside derived from the sugar mannose. This compound features a furanose ring structure, which is characteristic of certain monosaccharides, and is modified with a phenylmethyl group and an isopropylidene protecting group at the 2 and 3 positions. The presence of the phenylmethyl group enhances its hydrophobic characteristics, which can influence its solubility and reactivity in various chemical environments. The isopropylidene group serves as a protective group, stabilizing the molecule during synthetic processes. This compound is of interest in carbohydrate chemistry and can be utilized in the synthesis of more complex glycosides or as a building block in the development of pharmaceuticals and other biologically active compounds. Its specific reactivity and interactions would depend on the functional groups present and the overall molecular conformation, making it a subject of study in both synthetic and medicinal chemistry.
Formula:C16H22O6
InChI:InChI=1/C16H22O6/c1-16(2)21-13-12(11(18)8-17)20-15(14(13)22-16)19-9-10-6-4-3-5-7-10/h3-7,11-15,17-18H,8-9H2,1-2H3/t11-,12?,13?,14-,15+/m1/s1
InChI key:InChIKey=NKCNUNUEQRYLNZ-MRLBHPIUSA-N
SMILES:[C@H](CO)(O)[C@@]1([C@]2([C@@]([C@@H](OCC3=CC=CC=C3)O1)(OC(C)(C)O2)[H])[H])[H]
Synonyms:- Mannofuranoside, benzyl 2,3-O-isopropylidene-, α-D-
- Benzyl 2,3-O-isopropylidene-α-D-mannofuranoside
- Phenylmethyl 2,3-O-(1-methylethylidene)-α-D-mannofuranoside
- Furo[3,4-d]-1,3-dioxole, α-D-mannofuranoside deriv.
- α-D-Mannofuranoside, phenylmethyl 2,3-O-(1-methylethylidene)-
- (1R)-1-((4R,6S,6aR)-6-(benzyloxy)-2,2-dimethyltetrahydrofuro[3,4-d][1,3]dioxol-4-yl)ethane-1,2-diol
- Benzyl 2-O,3-O-isopropylidene-α-D-mannofuranoside
- Benzyl 2,3-O-isopropylidene-alpha-D-mannofuranoside min. 98%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzyl 2,3-O-Isopropylidene-a-D-mannofuranoside
CAS:Formula:C16H22O6Color and Shape:SolidMolecular weight:310.3423Benzyl 2,3-O-isopropylidene-α-D-mannofuranoside
CAS:Benzyl 2,3-O-isopropylidene-α-D-mannofuranosidePurity:>98%Molecular weight:310.34g/molBenzyl 2,3-O-Isopropylidene-alpha-D-mannofuranoside
CAS:Controlled ProductApplications Benzyl 2,3-O-Isopropylidene-α-D-mannofuranoside (cas# 20689-03-6) is a compound useful in organic synthesis.
Formula:C16H22O6Color and Shape:NeatMolecular weight:310.34Benzyl 2,3-O-isopropylidene-α-D-mannofuranoside
CAS:Benzyl 2,3-O-isopropylidene-a-D-mannofuranoside is a fluorinated monosaccharide that is synthesized using glycosylation and polysaccharide modification. This product has a CAS number of 20689-03-6 and can be used for complex carbohydrate synthesis. It has been shown to have high purity.
Formula:C16H22O6Purity:Min. 95%Color and Shape:PowderMolecular weight:310.34 g/molRef: 3D-MB04631
Discontinued product




