CAS 2069-32-1
:7-Nitro-2-(trifluoromethyl)-10H-phenothiazine
Description:
7-Nitro-2-(trifluoromethyl)-10H-phenothiazine, with the CAS number 2069-32-1, is a chemical compound belonging to the phenothiazine class, which is characterized by a tricyclic structure containing sulfur and nitrogen atoms. This compound features a nitro group and a trifluoromethyl group, which significantly influence its chemical reactivity and physical properties. The presence of the nitro group typically enhances the compound's electron-withdrawing characteristics, while the trifluoromethyl group can impart unique lipophilicity and stability. As a result, 7-Nitro-2-(trifluoromethyl)-10H-phenothiazine may exhibit interesting biological activities, making it of interest in pharmaceutical research. The compound is likely to be a solid at room temperature, with potential applications in medicinal chemistry, particularly in the development of therapeutic agents. Its synthesis and handling require standard laboratory safety protocols due to the presence of potentially hazardous functional groups. Overall, this compound exemplifies the diverse chemistry of phenothiazines and their derivatives.
Formula:C13H7F3N2O2S
InChI:InChI=1/C13H7F3N2O2S/c14-13(15,16)7-1-4-11-10(5-7)17-9-3-2-8(18(19)20)6-12(9)21-11/h1-6,17H
InChI key:InChIKey=LLVCJYBCDMKVPS-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C2C(SC=3C(N2)=CC=C(N(=O)=O)C3)=CC1
Synonyms:- 10H-Phenothiazine, 7-nitro-2-(trifluoromethyl)-
- Phenothiazine, 7-nitro-2-(trifluoromethyl)-
- 7-Nitro-2-(trifluoromethyl)-10H-phenothiazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
