CAS 20697-20-5
:methysticin
Description:
Methysticin is a naturally occurring compound primarily found in the plant species *Piper methysticum*, commonly known as kava. It belongs to the class of compounds known as kavalactones, which are responsible for the psychoactive effects of kava. Methysticin is characterized by its unique chemical structure, which includes a lactone ring, contributing to its biological activity. This compound is known for its potential anxiolytic and sedative properties, making it of interest in both traditional medicine and modern herbal supplements. Methysticin has been studied for its effects on the central nervous system, and it may influence neurotransmitter systems, particularly GABAergic pathways. Additionally, it exhibits antioxidant properties, which may contribute to its overall health benefits. However, like other kavalactones, methysticin's safety profile and potential side effects, especially concerning liver health, warrant careful consideration and further research. Overall, methysticin represents a significant area of interest in phytochemistry and pharmacology due to its therapeutic potential and cultural significance.
Formula:C15H14O5
InChI:InChI=1/C15H14O5/c1-17-12-7-11(20-15(16)8-12)4-2-10-3-5-13-14(6-10)19-9-18-13/h2-6,8,11H,7,9H2,1H3/b4-2+/t11-/m1/s1
Synonyms:- (6S)-6-[(E)-2-(1,3-Benzodioxol-5-yl)vinyl]-4-methoxy-5,6-dihydro-2H-pyran-2-one
- 2H-pyran-2-one, 6-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-5,6-dihydro-4-methoxy-, (6S)-
- (2S)-2-[(E)-2-(1,3-benzodioxol-5-yl)vinyl]-4-methoxy-2,3-dihydropyran-6-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Methysticin
CAS:Methysticin, a major kavalactone extracted from kava, can induce CYP1A1.Formula:C15H14O5Purity:98%Color and Shape:SolidMolecular weight:274.27DL-Methysticin
CAS:DL-Methysticin is a drug that is used in the preparation of samples for analytical methods such as preparative HPLC. It also induces drug interactions with 5-HT, which leads to increased concentrations of this neurotransmitter. DL-Methysticin has been shown to induce neuronal death and is not recommended for use in patients with ischemic brain damage. The drug may be used in the treatment of infectious diseases, but it should be administered cautiously due to its significant interactions with acetate extract and fatty acid.Formula:C15H14O5Purity:Min. 95%Molecular weight:274.27 g/mol


