CAS 206986-79-0
:Chlorhexidine acetate
Description:
Chlorhexidine acetate is a chemical compound that belongs to the class of bisbiguanides, primarily known for its antiseptic properties. It is characterized by its broad-spectrum antimicrobial activity, making it effective against a variety of bacteria, fungi, and some viruses. The compound is typically used in medical and dental applications, including mouthwashes, skin disinfectants, and surgical scrubs, due to its ability to reduce microbial load and prevent infections. Chlorhexidine acetate is soluble in water and exhibits a relatively low toxicity profile, which enhances its suitability for topical applications. Its mechanism of action involves disrupting microbial cell membranes and precipitating cellular contents, leading to cell death. Additionally, chlorhexidine acetate is often favored for its residual antimicrobial activity, providing prolonged protection after application. However, it is essential to use this compound with caution, as it can cause skin irritation or allergic reactions in some individuals. Overall, chlorhexidine acetate is a valuable agent in infection control and hygiene practices.
Formula:C22H30Cl2N10(C2H4O2)
InChI:InChI=1/C22H30Cl2N10.2C2H4O2/c23-15-5-9-17(10-6-15)31-21(27)33-19(25)29-13-3-1-2-4-14-30-20(26)34-22(28)32-18-11-7-16(24)8-12-18;2*1-2(3)4/h5-12H,1-4,13-14H2,(H5,25,27,29,31,33)(H5,26,28,30,32,34);2*1H3,(H,3,4)
Synonyms:- Chlorhexidine di(acetate)
- 1,6-Bis(N5-[p-chlorophenyl]-N1-biguanido)hexane
- Chlorhexidine di acetate
- 2,2'-hexane-1,6-diylbis(1-{(E)-amino[(4-chlorophenyl)amino]methylidene}guanidine) acetate (1:2)
- Chlorhexidine diacetate
- Hibitane diacetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Chlorhexidine acetate hydrate(1:2:x)
CAS:Formula:C26H40Cl2N10O5Purity:98%Color and Shape:SolidMolecular weight:643.5658Chlorhexidine Diacetate Hydrate
CAS:Chlorhexidine Diacetate HydratePurity:98%Molecular weight:625.55g/molChlorhexidine acetate hydrate(1:2:X)
CAS:Controlled Product<p>Chlorhexidine acetate hydrate (1:2:X) is a chemical compound used as a disinfectant and antiseptic. It is derived from chlorhexidine, a well-known antimicrobial agent frequently used in both medical and laboratory settings. The compound functions by disrupting microbial cell membranes, resulting in leakage of cellular components and subsequent cell death. This action makes it particularly effective against a wide range of bacteria, fungi, and some viruses.</p>Formula:C26H38Cl2N10O4Purity:Min. 95%Molecular weight:625.5 g/mol


