CAS 206986-83-6
:N-(2-Chloro-5-methyl-4-nitrophenyl)benzamide
Description:
N-(2-Chloro-5-methyl-4-nitrophenyl)benzamide is an organic compound characterized by its aromatic structure, which includes a benzamide moiety and a substituted phenyl group. The presence of a chloro group, a methyl group, and a nitro group on the phenyl ring contributes to its unique chemical properties and reactivity. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic aromatic structure. The nitro group is known for its electron-withdrawing properties, which can influence the compound's reactivity in electrophilic aromatic substitution reactions. Additionally, the chloro substituent can participate in nucleophilic substitution reactions, while the methyl group can affect steric hindrance and electronic distribution. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and utility in synthesizing other chemical entities. Safety and handling precautions should be observed, as with many halogenated and nitro-substituted compounds, due to potential toxicity and environmental concerns.
Formula:C14H11ClN2O3
InChI:InChI=1/C14H11ClN2O3/c1-9-7-12(11(15)8-13(9)17(19)20)16-14(18)10-5-3-2-4-6-10/h2-8H,1H3,(H,16,18)
InChI key:InChIKey=FSQMLSBGODTGQF-UHFFFAOYSA-N
SMILES:N(C(=O)C1=CC=CC=C1)C2=C(Cl)C=C(N(=O)=O)C(C)=C2
Synonyms:- Benzamide, N-(2-chloro-5-methyl-4-nitrophenyl)-
- N-(2-chloro-5-methyl-4-nitrophenyl)benzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
