CAS 206996-60-3: Acetic acid, cerium(3+) salt, hydrate
Description:Acetic acid, cerium(3+) salt, hydrate, with the CAS number 206996-60-3, is a coordination compound formed from cerium ions and acetic acid. This substance typically appears as a crystalline solid and is characterized by its solubility in water, which is influenced by the presence of the hydrate form. Cerium(3+) ions in this compound exhibit a +3 oxidation state, which is common for lanthanide elements, and contribute to its unique chemical properties, including potential catalytic activity and redox behavior. The acetic acid component provides a weakly acidic environment, which can influence the stability and reactivity of the cerium ions. This compound may be utilized in various applications, including materials science, catalysis, and as a precursor in the synthesis of other cerium-based materials. Its hydration state is significant, as it can affect the compound's physical properties, such as melting point and solubility. Overall, acetic acid, cerium(3+) salt, hydrate is an interesting compound with potential applications in both research and industry.
Formula:C2H4O2Ce·xH2O
InChI:InChI=1S/C2H4O2.Ce.H2O/c1-2(3)4;;/h1H3,(H,3,4);;1H2
InChI key:InChIKey=OKGRYXNRUMZNDO-UHFFFAOYSA-N
SMILES:[Ce].O=C(O)C.O
- Synonyms:
- Acetate, Cerium(3+) Salt (1:1)
- Acetate, Cerium(3+) Salt, Hydrate (1:1:1)
- Acetic acid, cerium(3+) salt, hydrate
- Acetic acid, cerium(3+) salt, hydrate (2:3)
- Aceticacid,Cerium(3+)Salt
- Cerium(3+) Acetate
- Cerium(III) acetate
- Cerium(Iii) Acetate Sesquihydrate
- Ceriumtriacetate
- Ceticacid,Cerium(3+)Salt
- See more synonyms
- Cerium (III) acetate hydrate
