CAS 206997-15-1
:2-amino-5-bromopyridine-3-carbaldehyde
Description:
2-Amino-5-bromopyridine-3-carbaldehyde is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features an amino group (-NH2) and a bromine atom at the 5-position of the pyridine ring, while a formyl group (-CHO) is located at the 3-position. The presence of these functional groups imparts specific reactivity and properties to the molecule, making it useful in various chemical syntheses and applications, particularly in medicinal chemistry and the development of pharmaceuticals. The amino group can participate in nucleophilic reactions, while the aldehyde group is reactive towards nucleophiles, allowing for further derivatization. Additionally, the bromine atom can serve as a leaving group in substitution reactions. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents. Its unique structure and functional groups make it a valuable intermediate in the synthesis of more complex organic molecules.
Formula:C6H5BrN2O
InChI:InChI=1/C6H5BrN2O/c7-5-1-4(3-10)6(8)9-2-5/h1-3H,(H2,8,9)
SMILES:c1c(C=O)c(=N)[nH]cc1Br
Synonyms:- 2-Amino-5-bromo-3-pyridinecarboxaldehyde
- 2-Amino-5-bromonicotinaldehyde
- 2-Amino-5-bromopyridine-3-carboxaldehyde
- 3-Pyridinecarboxaldehyde, 2-amino-5-bromo-
- T6Nj Bz Cvh Ee
- 2-Amino-5-bromopyridine-3-carbaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Pyridinecarboxaldehyde, 2-amino-5-bromo-
CAS:Formula:C6H5BrN2OPurity:95%Color and Shape:SolidMolecular weight:201.0207Ref: IN-DA002ISV
1g46.00€5g91.00€10g117.00€1kgTo inquire25g200.00€100g500.00€500gTo inquire100mg25.00€250mg25.00€2-Amino-5-bromonicotinaldehyde
CAS:2-Amino-5-bromonicotinaldehydePurity:98%Color and Shape:Yellow PowderMolecular weight:201.02g/mol2-Amino-5-bromonicotinaldehyde
CAS:Formula:C6H5BrN2OPurity:95%Color and Shape:SolidMolecular weight:201.0232-amino-5-bromo-3-pyridinecarbaldehyde
CAS:<p>2-Amino-5-bromo-3-pyridinecarbaldehyde is a chemical intermediate that is used in the industrial production of nicotinamide. The cyclization of 2-amino-5-bromo-3-pyridinecarbaldehyde requires an extended reaction time. Acidolysis of this compound yields nicotinic acid, which can be brominated to produce nicotinic acid methyl ester.</p>Formula:C6H5BrN2OPurity:Min. 95%Molecular weight:201 g/mol



