CAS 206997-15-1

2-amino-5-bromopyridine-3-carbaldehyde

Description:

2-Amino-5-bromopyridine-3-carbaldehyde is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features an amino group (-NH2) and a bromine atom at the 5-position of the pyridine ring, while a formyl group (-CHO) is located at the 3-position. The presence of these functional groups imparts specific reactivity and properties to the molecule, making it useful in various chemical syntheses and applications, particularly in medicinal chemistry and the development of pharmaceuticals. The amino group can participate in nucleophilic reactions, while the aldehyde group is reactive towards nucleophiles, allowing for further derivatization. Additionally, the bromine atom can serve as a leaving group in substitution reactions. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents. Its unique structure and functional groups make it a valuable intermediate in the synthesis of more complex organic molecules.

Formula: C₆H₅BrN₂O

InChI: InChI=1/C6H5BrN2O/c7-5-1-4(3-10)6(8)9-2-5/h1-3H,(H2,8,9)

SMILES: c1c(C=O)c(=N)[nH]cc1Br

Synonyms:

• 2-Amino-5-bromo-3-pyridinecarboxaldehyde
• 2-Amino-5-bromonicotinaldehyde
• 2-Amino-5-bromopyridine-3-carboxaldehyde
• 3-Pyridinecarboxaldehyde, 2-amino-5-bromo-
• T6Nj Bz Cvh Ee
• 2-Amino-5-bromopyridine-3-carbaldehyde

3-Pyridinecarboxaldehyde, 2-amino-5-bromo-

CAS: 206997-15-1

Formula: C₆H₅BrN₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 201.0207

Ref: IN-DA002ISV

2-Amino-5-bromonicotinaldehyde

CAS: 206997-15-1

2-Amino-5-bromonicotinaldehyde

Purity: 98%

Color and Shape: Yellow Powder

Molecular weight: 201.02g/mol

Ref: 54-OR3672

2-Amino-5-bromonicotinaldehyde

CAS: 206997-15-1

Formula: C₆H₅BrN₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 201.023

Ref: 10-F046394

2-amino-5-bromo-3-pyridinecarbaldehyde

CAS: 206997-15-1

2-Amino-5-bromo-3-pyridinecarbaldehyde is a chemical intermediate that is used in the industrial production of nicotinamide. The cyclization of 2-amino-5-bromo-3-pyridinecarbaldehyde requires an extended reaction time. Acidolysis of this compound yields nicotinic acid, which can be brominated to produce nicotinic acid methyl ester.

Formula: C₆H₅BrN₂O

Purity: Min. 95%

Molecular weight: 201 g/mol

Ref: 3D-GIA99715