CAS 2070014-94-5

1-Pyrrolidinecarboxamide, 3-[[[(4-chlorophenyl)methyl][(5-nitro-2-thienyl)methyl]amino]methyl]-N-pentyl-, hydrochloride (1:1)

Description:

1-Pyrrolidinecarboxamide, 3-[[[(4-chlorophenyl)methyl][(5-nitro-2-thienyl)methyl]amino]methyl]-N-pentyl-, hydrochloride (1:1) is a synthetic compound characterized by its complex molecular structure, which includes a pyrrolidine ring, a carboxamide functional group, and various aromatic substituents. The presence of a 4-chlorophenyl group and a 5-nitro-2-thienyl moiety contributes to its potential biological activity, possibly influencing its pharmacological properties. As a hydrochloride salt, it is typically more soluble in water, enhancing its bioavailability for potential therapeutic applications. The compound may exhibit properties such as being a potential ligand for specific receptors or enzymes, making it of interest in medicinal chemistry. Its molecular interactions, stability, and reactivity can be influenced by the functional groups present, which may also affect its toxicity and environmental impact. Further studies would be necessary to elucidate its specific applications and safety profile in biological systems.

Formula: C₂₃H₃₁ClN₄O₃S·ClH

InChI: InChI=1S/C23H31ClN4O3S.ClH/c1-2-3-4-12-25-23(29)27-13-11-19(16-27)15-26(14-18-5-7-20(24)8-6-18)17-21-9-10-22(32-21)28(30)31;/h5-10,19H,2-4,11-17H2,1H3,(H,25,29);1H

InChI key: InChIKey=ADTZBBQVEUEODS-UHFFFAOYSA-N

SMILES: N(CC1CN(C(NCCCCC)=O)CC1)(CC=2SC(N(=O)=O)=CC2)CC3=CC=C(Cl)C=C3.Cl

Synonyms:

• 1-Pyrrolidinecarboxamide, 3-[[[(4-chlorophenyl)methyl][(5-nitro-2-thienyl)methyl]amino]methyl]-N-pentyl-, hydrochloride (1:1)

3-(((4-Chlorobenzyl)((5-nitrothiophen-2-yl)methyl)amino)methyl)-N-pentylpyrrolidine-1-carboxamide hydrochloride

CAS: 2070014-94-5

3-(((4-Chlorobenzyl)((5-nitrothiophen-2-yl)methyl)amino)methyl)-N-pentylpyrrolidine-1-carboxamide hydrochloride

Purity: 98%

Molecular weight: 515.51g/mol

Ref: 54-OR1067313

SR9011 hydrochloride

CAS: 2070014-94-5

SR9011 hydrochloride is a REV-ERBα/β agonist, exhibiting an IC50 value of 790 nM for REV-ERBα and 560 nM for REV-ERBβ.

Formula: C₂₃H₃₂Cl₂N₄O₃S

Color and Shape: Solid

Molecular weight: 515.49

Ref: TM-T39473

Sr9011 hydrochloride

Controlled Product

CAS: 2070014-94-5

**SR9011 hydrochloride** is a synthetic compound classified as a Rev-Erb agonist, which is derived from chemical synthesis. Its mode of action involves binding to the Rev-Erbα and Rev-Erbβ nuclear receptors, which play a crucial role in controlling the circadian rhythm and metabolic pathways. By activating these receptors, SR9011 hydrochloride influences the expression of genes involved in lipid and glucose metabolism, leading to enhanced metabolic activity and energy expenditure.

The primary applications of SR9011 hydrochloride are in research settings, where it is used to investigate the physiological and biochemical effects of Rev-Erb activation. Studies have explored its potential to modulate sleep-wake cycles, reduce fat accumulation, and improve exercise capacity in various animal models. Its ability to alter metabolic functions makes it a valuable tool for probing the pathways underlying obesity, diabetes, and other metabolic disorders. Researchers continue to study SR9011 hydrochloride to uncover further insights into its broader therapeutic potential and mechanistic pathways.

Formula: C₂₃H₃₂Cl₂N₄O₃S

Purity: Min. 95%

Molecular weight: 515.5 g/mol

Ref: 3D-VHD01494