CAS 207121-48-0
:L-cysteinesulfinic acid monohydrate
Description:
L-cysteinesulfinic acid monohydrate is an amino acid derivative characterized by its sulfinic acid functional group. It is a white crystalline solid that is soluble in water, reflecting its polar nature due to the presence of both amino and sulfinic acid groups. This compound is a naturally occurring intermediate in the metabolism of cysteine and plays a role in various biochemical processes, including the synthesis of taurine and the regulation of oxidative stress. L-cysteinesulfinic acid can participate in redox reactions, making it relevant in studies of cellular antioxidant mechanisms. The monohydrate form indicates the presence of one water molecule per molecule of the compound, which can influence its stability and solubility. In terms of safety, like many amino acids and their derivatives, it should be handled with care, as its effects on health and the environment are still being studied. Overall, L-cysteinesulfinic acid monohydrate is significant in both biological systems and potential therapeutic applications.
Formula:C3H9NO5S
InChI:InChI=1/C3H7NO4S.H2O/c4-2(3(5)6)1-9(7)8;/h2H,1,4H2,(H,5,6)(H,7,8);1H2/t2-;/m0./s1
SMILES:C([C@@H](C(=O)O)N)S(=O)O.O
Synonyms:- 3-sulfino-L-alanine hydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
L-Alanine, 3-sulfino-, hydrate (1:1)
CAS:Formula:C3H9NO5SPurity:99%Color and Shape:SolidMolecular weight:171.1723L-Cysteinesulfinic acid monohydrate
CAS:L-Cysteinesulfinic acid monohydratePurity:≥98%Molecular weight:171.17g/molL-Cysteinesulphinic acid monohydrate
CAS:L-Cysteinesulphinic acid monohydratePurity:98%Molecular weight:171.17g/molL-Cysteinesulfinic acid monohydrate
CAS:<p>L-Cysteinesulfinic acid monohydrate activates rat mGluR1/2/4/5/6/8 with pEC50s of 3.92, 3.9, 2.7, 4.6, 4.0, 3.94 respectively.</p>Formula:C3H9NO5SPurity:≥98%Color and Shape:SolidMolecular weight:171.17L-Cysteinesulfinic Acid, Monohydrate
CAS:Controlled Product<p>Applications An amino acid derivative with neuropathological interest; Putative excitatory amino acid neurotransmitter.<br>References Griffiths, R., Prog. Neurobiol., 35, 313 (1990)<br></p>Formula:C3H7NO4S·H2OColor and Shape:NeatMolecular weight:171.17L-Cysteinesulfinic acid, monohydrate
CAS:<p>Please enquire for more information about L-Cysteinesulfinic acid, monohydrate including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C3H7NO4S·H2OPurity:Min. 95%Molecular weight:171.17 g/mol






