CAS 20716-98-7
:Norlichexanthone
Description:
Norlichexanthone, with the CAS number 20716-98-7, is a naturally occurring xanthone derivative primarily found in certain plant species. It is characterized by its yellow crystalline appearance and is known for its potential biological activities, including antioxidant, anti-inflammatory, and antimicrobial properties. The molecular structure of norlichexanthone features a polycyclic aromatic system, which contributes to its stability and reactivity. This compound is of interest in pharmacological research due to its ability to interact with various biological targets, making it a candidate for further studies in drug development. Additionally, norlichexanthone may exhibit fluorescence, which can be useful in analytical applications. Its solubility varies depending on the solvent, and it is typically soluble in organic solvents while being less soluble in water. Overall, norlichexanthone represents a significant compound in the field of natural products chemistry, with ongoing research aimed at elucidating its full range of biological effects and potential therapeutic applications.
Formula:C14H10O5
InChI:InChI=1S/C14H10O5/c1-6-2-7(15)4-10-12(6)14(18)13-9(17)3-8(16)5-11(13)19-10/h2-5,15-17H,1H3
InChI key:InChIKey=AQZHBCDRWFMXIN-UHFFFAOYSA-N
SMILES:O=C1C=2C(OC=3C1=C(O)C=C(O)C3)=CC(O)=CC2C
Synonyms:- 1,3,6-Trihydroxy-8-methylxanthone
- 3,6,8-Trihydroxy-1-methyl-9H-xanthen-9-one
- 3,6,8-Trihydroxy-1-methylxanthone
- 9H-Xanthen-9-one, 1,3,6-trihydroxy-8-methyl-
- Fusarindin
- Norlichexanthone
- Xanthen-9-one, 1,3,6-trihydroxy-8-methyl-
- 1,3,6-Trihydroxy-8-methyl-9H-xanthen-9-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Norlichexanthone
CAS:Formula:C14H10O5Purity:100.0%Color and Shape:Brown. PowderMolecular weight:258.0Norlichexanthone
CAS:Norlichexanthone has the potential to treat and/or prevent lifestyle-related diseases such as type 2 diabetes, metabolic syndrome, atherosclerosis andFormula:C14H10O5Purity:98%Color and Shape:SolidMolecular weight:258.23Norlichexanthone
CAS:Formula:C14H10O5Purity:95%~99%Color and Shape:Yellow powderMolecular weight:258.229Norlichexanthone
CAS:Norlichexanthone is a bioactive compound classified as a xanthone, which is a type of polyphenolic compound. It is naturally sourced from various lichens and fungi, making it an intriguing subject for natural product chemistry studies. Norlichexanthone operates through diverse biochemical pathways, potentially exhibiting antimicrobial, antioxidant, and anticancer properties, among others. These properties are attributed to its ability to modulate oxidative stress and interact with cellular targets, although the full extent of its mode of action remains a domain of ongoing research.
Formula:C14H10O5Purity:Min. 95%Molecular weight:258.23 g/mol





