CAS 20718-46-1
:5-Chloro-4-nitro-2,1,3-benzoselenadiazole
Description:
5-Chloro-4-nitro-2,1,3-benzoselenadiazole is a heterocyclic compound that features a selenadiazole ring fused to a benzene structure, characterized by the presence of chlorine and nitro substituents. This compound typically exhibits a yellow to orange crystalline appearance and is known for its potential applications in organic synthesis and materials science, particularly in the development of electronic materials and dyes. The presence of the chlorine and nitro groups contributes to its reactivity and may influence its electronic properties, making it of interest in various chemical reactions. Additionally, the selenadiazole moiety can impart unique photophysical properties, which are valuable in the design of sensors and optoelectronic devices. As with many heterocyclic compounds, it is essential to handle this substance with care, considering its potential toxicity and environmental impact. Proper safety protocols should be followed when working with this compound in a laboratory setting.
Formula:C6H2ClN3O2Se
InChI:InChI=1S/C6H2ClN3O2Se/c7-3-1-2-4-5(9-13-8-4)6(3)10(11)12/h1-2H
InChI key:InChIKey=TZPWJERFLDFTSH-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=2C(C=CC1Cl)=N[Se]N2
Synonyms:- 5-Chloro-4-nitro-2,1,3-benzoselenadiazole
- 2,1,3-Benzoselenadiazole, 5-chloro-4-nitro-
- 5-Chloro-4-nitrobenzo-2,1,3-selenadiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2,1,3-Benzoselenadiazole, 5-chloro-4-nitro-
CAS:Formula:C6H2ClN3O2SeColor and Shape:SolidMolecular weight:262.5125-Chloro-4-nitro-2,1,3-benzoselenadiazole
CAS:Controlled ProductApplications 5-Chloro-4-nitro-2,1,3-benzoselenadiazole (cas# 20718-46-1) is a compound useful in organic synthesis.
References Turesky, R., et al.: J. Agric. Food Chem., 53, 3248 (2005),Formula:C6H2ClN3O2SeColor and Shape:NeatMolecular weight:262.51

