CymitQuimica logo

CAS 20718-99-4

:

(2E)-3-[4-(3-methylbutoxy)phenyl]prop-2-enoic acid

Description:
(2E)-3-[4-(3-methylbutoxy)phenyl]prop-2-enoic acid, with the CAS number 20718-99-4, is an organic compound characterized by its structure, which features a prop-2-enoic acid backbone substituted with a 4-(3-methylbutoxy)phenyl group. This compound is likely to exhibit properties typical of unsaturated carboxylic acids, including the ability to participate in various chemical reactions such as esterification and polymerization due to the presence of the double bond and the carboxylic acid functional group. The presence of the bulky 3-methylbutoxy substituent may influence its solubility, boiling point, and reactivity, potentially making it less polar compared to simpler carboxylic acids. Additionally, the compound may have applications in organic synthesis or as an intermediate in the production of more complex molecules. Its specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or detailed literature reference for precise values.
Formula:C14H18O3
InChI:InChI=1/C14H18O3/c1-11(2)9-10-17-13-6-3-12(4-7-13)5-8-14(15)16/h3-8,11H,9-10H2,1-2H3,(H,15,16)/b8-5+
Synonyms:
  • 2-propenoic acid, 3-[4-(3-methylbutoxy)phenyl]-, (2E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.