CAS 20721-17-9

5-methylpyrazin-2(1H)-one

Description:

5-Methylpyrazin-2(1H)-one, with the CAS number 20721-17-9, is a heterocyclic organic compound characterized by a pyrazine ring substituted with a methyl group and a carbonyl group. This compound features a five-membered ring structure containing two nitrogen atoms, which contributes to its basicity and potential reactivity. It is typically a colorless to pale yellow solid, exhibiting moderate solubility in polar solvents such as water and alcohols. The presence of the carbonyl group enhances its reactivity, allowing it to participate in various chemical reactions, including nucleophilic additions and condensation reactions. 5-Methylpyrazin-2(1H)-one is of interest in the fields of medicinal chemistry and agrochemicals, as it may exhibit biological activity and serve as a building block for the synthesis of more complex molecules. Its stability and reactivity make it a valuable compound for research and development in organic synthesis.

Formula: C₅H₆N₂O

InChI: InChI=1/C5H6N2O/c1-4-2-7-5(8)3-6-4/h2-3H,1H3,(H,7,8)

SMILES: Cc1c[nH]c(=O)cn1

Synonyms:

• 2-Pyrazinol, 5-Methyl-
• 5-Methylpyrazin-2-ol

2(1H)-Pyrazinone, 5-methyl-

CAS: 20721-17-9

Formula: C₅H₆N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 110.1139

Ref: IN-DA002IWM

5-Methylpyrazin-2(1H)-one

CAS: 20721-17-9

5-Methylpyrazin-2(1H)-one is a pyrazinone derivative widely used in biochemical experiments and drug synthesis research.

Formula: C₅H₆N₂O

Purity: 99.88%

Color and Shape: Solid

Molecular weight: 110.11

Ref: TM-TN9745

2-Hydroxy-5-methylpyrazine

CAS: 20721-17-9

2-Hydroxy-5-methylpyrazine

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 110.11g/mol

Ref: 54-OR40054

2-Hydroxy-5-methylpyrazine

CAS: 20721-17-9

Formula: C₅H₆N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 110.116

Ref: 10-F077046

5-Methyl-2(1H)-pyrazinone

Controlled Product

CAS: 20721-17-9

Formula: C₅H₆N₂O

Color and Shape: Neat

Molecular weight: 110.114

Ref: TR-M324900