CAS 20724-73-6
:2'-C-Methylcytidine
Description:
2'-C-Methylcytidine is a modified nucleoside that features a methyl group at the 2' position of the ribose sugar moiety of cytidine. This modification can influence the stability and biological activity of nucleic acids, making it of interest in various biochemical and pharmaceutical applications. The presence of the methyl group enhances the resistance of the nucleoside to enzymatic degradation, which can be beneficial in therapeutic contexts. 2'-C-Methylcytidine is often studied for its potential role in antiviral therapies, particularly against RNA viruses, as it can interfere with viral replication processes. Additionally, it may exhibit unique properties in terms of base pairing and hydrogen bonding, which can affect its incorporation into RNA strands. The compound is typically characterized by its molecular formula, which reflects its constituent elements, and its structural features can be analyzed using techniques such as NMR spectroscopy and mass spectrometry. Overall, 2'-C-Methylcytidine represents a significant area of research in the field of medicinal chemistry and molecular biology.
Formula:C10H15N3O5
InChI:InChI=1/C10H15N3O5/c1-10(17)7(15)5(4-14)18-8(10)13-3-2-6(11)12-9(13)16/h2-3,5,7-8,14-15,17H,4H2,1H3,(H2,11,12,16)/t5-,7-,8-,10-/m1/s1
SMILES:C[C@]1([C@@H]([C@@H](CO)O[C@H]1n1ccc(=N)nc1O)O)O
Synonyms:- cytidine, 2'-C-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Cytidine, 2'-C-methyl-
CAS:Formula:C10H15N3O5Purity:98%Color and Shape:SolidMolecular weight:257.24322''-C-Methylcytidine
CAS:Formula:C10H15N3O5Purity:≥ 96.0%Color and Shape:White to off-white powderMolecular weight:257.25NM107
CAS:NM107, a ribonucleoside, inhibits HCV NS5B polymerase. It has broad antiviral properties with EC50 of 1.85 μM in wild-type cells.Formula:C10H15N3O5Purity:97.85%Color and Shape:White To Off-White PowderMolecular weight:257.242'-C-Methylcytidine
CAS:Broad-spectrum anti-viral; inhibitor of HCV NS5B RNA polymeraseFormula:C10H15N3O5Purity:Min. 98 Area-%Color and Shape:White Off-White PowderMolecular weight:257.25 g/mol2′-C-Methylcytidine
CAS:Formula:C10H15N3O5Purity:98%Color and Shape:No data available.Molecular weight:257.2462’-C-Methyl Cytidine
CAS:Controlled ProductApplications 2’-C-Methyl Cytidine (cas# 20724-73-6) is a compound useful in organic synthesis.
Formula:C10H15N3O5Color and Shape:NeatMolecular weight:257.24






