CAS 20727-65-5
:L-Alanyl-L-aspartic acid
Description:
L-Alanyl-L-aspartic acid, also known as ALA-ASP, is a dipeptide composed of the amino acids L-alanine and L-aspartic acid. It is characterized by its role in various biological processes, including protein synthesis and cellular signaling. This compound is typically a white to off-white crystalline powder, soluble in water, which makes it suitable for various biochemical applications. L-Alanyl-L-aspartic acid exhibits properties such as being non-toxic and having a relatively stable structure under physiological conditions. It is often studied for its potential benefits in enhancing cognitive function and as a nutritional supplement. Additionally, it may play a role in metabolic pathways and has been investigated for its effects on muscle recovery and performance in sports science. The compound's CAS number, 20727-65-5, is a unique identifier that facilitates its recognition in scientific literature and regulatory contexts. Overall, L-Alanyl-L-aspartic acid is a significant compound in both research and potential therapeutic applications.
Formula:C7H12N2O5
InChI:InChI=1S/C7H12N2O5/c1-3(8)6(12)9-4(7(13)14)2-5(10)11/h3-4H,2,8H2,1H3,(H,9,12)(H,10,11)(H,13,14)/t3-,4-/m0/s1
InChI key:InChIKey=XAEWTDMGFGHWFK-IMJSIDKUSA-N
SMILES:[C@H](NC([C@H](C)N)=O)(CC(O)=O)C(O)=O
Synonyms:- 148: PN: EP2161028 PAGE: 10 claimed protein
- 68: PN: US20070066537 PAGE: 17 claimed protein
- 71: PN: WO2014170713 SEQID: 177 claimed protein
- <span class="text-smallcaps">L</smallcap>-Alanyl-<smallcap>L</span>-aspartic acid
- <span class="text-smallcaps">L</smallcap>-Aspartic acid, <smallcap>L</span>-alanyl-
- <span class="text-smallcaps">L</smallcap>-Aspartic acid, N-<smallcap>L</span>-alanyl-
- Alanylaspartic Acid
- Aspartic acid, N-<span class="text-smallcaps">L</smallcap>-alanyl-, <smallcap>L</span>-
- H-Ala-Asp-OH
- L-alanyl-L-aspartic acid
- NSC 186912
- L-Aspartic acid, N-L-alanyl-
- Aspartic acid, N-L-alanyl-, L-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
H-Ala-Asp-OH
CAS:Ala-Asp was shown to induce chloride excretion in proximal tubule cells.Formula:C7H12N2O5Purity:>99%Color and Shape:White PowderMolecular weight:204.18Alanylaspartic acid
CAS:Alanylaspartic acid is a biochemical.Formula:C7H12N2O5Color and Shape:SolidMolecular weight:204.18H-Ala-Asp-OH
CAS:Controlled Product<p>Stability Hygroscopic<br>Applications H-ALA-ASP-OH (cas# 20727-65-5) is a useful research chemical.<br></p>Formula:C7H12N2O5Color and Shape:NeatMolecular weight:204.18H-Ala-Asp-OH
CAS:<p>H-Ala-Asp-OH is a tetrapeptide that belongs to the group of p2, acidic, magnetic and isomeric haemoglobins. This molecule has been shown to hydrolyze enzymes in red blood cells. H-Ala-Asp-OH also binds to red blood cells and may be involved in the regulation of oxygen transport. The magnetic properties of this molecule have been studied by NMR spectroscopy and X-ray crystallography.</p>Formula:C7H12N2O5Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:204.18 g/mol



