CymitQuimica logo

CAS 207287-79-4

:

3'-Methoxybiphenyl-4-amine

Description:
3'-Methoxybiphenyl-4-amine, with the CAS number 207287-79-4, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a methoxy group (-OCH₃) at the 3' position and an amino group (-NH₂) at the 4 position on the biphenyl framework contributes to its chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its hydrophobic biphenyl core, while the functional groups can engage in hydrogen bonding and enhance solubility in polar solvents. The methoxy group can influence the electronic properties of the molecule, potentially affecting its reactivity and interaction with other chemical species. 3'-Methoxybiphenyl-4-amine may have applications in organic synthesis, pharmaceuticals, or materials science, particularly in the development of dyes, pigments, or as intermediates in the synthesis of more complex organic molecules. Its specific reactivity and applications would depend on the context of its use in chemical research or industry.
Formula:C13H13NO
InChI:InChI=1/C13H13NO/c1-15-13-4-2-3-11(9-13)10-5-7-12(14)8-6-10/h2-9H,14H2,1H3
InChI key:OSWFIVFLDKOXQC-UHFFFAOYSA-N
SMILES:COc1cccc(c1)c1ccc(cc1)N
Synonyms:
  • [1,1'-Biphenyl]-4-amine, 3'-methoxy-
Found 3 products.