CAS 2073-35-0
:L-Iduronic acid
Description:
L-Iduronic acid is a naturally occurring uronic acid that plays a significant role in the structure of glycosaminoglycans, particularly in heparin and heparan sulfate. It is an epimer of D-glucuronic acid, differing in the configuration at the C5 carbon atom. This compound is characterized by its carboxylic acid functional group, which contributes to its acidic properties, and its hydroxyl groups, which enhance its solubility in water. L-Iduronic acid is typically found in a cyclic form, existing predominantly as a pyranose. Its structural features allow it to participate in various biological processes, including cell signaling and the regulation of cellular activities. The presence of L-iduronic acid in polysaccharides is crucial for maintaining the structural integrity and biological functions of extracellular matrices. Additionally, it has potential applications in pharmaceuticals and biotechnology due to its interactions with proteins and other biomolecules. Overall, L-iduronic acid is an important component in biochemistry and molecular biology, contributing to various physiological functions.
Formula:C6H10O7
InChI:InChI=1S/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h1-5,8-11H,(H,12,13)/t2-,3+,4-,5+/m0/s1
InChI key:InChIKey=IAJILQKETJEXLJ-SKNVOMKLSA-N
SMILES:[C@H]([C@@H]([C@H](C=O)O)O)([C@H](C(O)=O)O)O
Synonyms:- <span class="text-smallcaps">L</span>-Iduronic acid
- Iduronic acid, <span class="text-smallcaps">L</span>-
- L-idopyranuronic acid
- L-iduronic acid
- Iduronic acid, L-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
L-Iduronic acid
CAS:L-Iduronic acidPurity:>98%Color and Shape:White CrystalsMolecular weight:194.14g/molL-Iduronic acid sodium salt
CAS:Formula:C6H9NaO7Purity:(TLC) ≥ 98.0%Color and Shape:Light brown powderMolecular weight:216.12L-Iduronic acid
CAS:L-Iduronic acid is a monosaccharide that is a component of the glycosaminoglycans. It is a sodium ion salt, which can be found in the extracellular matrix as part of the glycosaminoglycan heparan sulfate. Iduronic acid has been shown to have hypoglycemic effects in rats and mice and inhibitory properties against human osteosarcoma cells. L-Iduronic acid inhibits the synthesis of methyl glycosides by inhibiting the enzyme glucosyltransferase, which catalyzes the formation of glucuronoxylorxylan from glucose and xylose. The oligosaccharides are composed of iduronic acid units linked by α-1,4 linkages with β-1,4 linkages between adjacent iduronic acid units. The conformational properties of iduronic acid have been analyzed using X-ray crystallography and nuclear magnetic resonance spectroscopy (NMRFormula:C6H10O7Purity:Min. 98 Area-%Color and Shape:White PowderMolecular weight:194.14 g/mol



