CymitQuimica logo

CAS 207300-70-7

:

D-glucuronic acid, sodium salt monohydrate

Description:
D-glucuronic acid, sodium salt monohydrate is a sodium salt derivative of D-glucuronic acid, a naturally occurring sugar acid that plays a crucial role in the detoxification processes in the body. This compound is typically found in a monohydrate form, meaning it contains one molecule of water for each molecule of the salt. It is characterized by its white to off-white crystalline appearance and is soluble in water, making it suitable for various biochemical applications. D-glucuronic acid is involved in the conjugation of drugs and toxins, facilitating their excretion from the body. The sodium salt form enhances its solubility and stability, making it useful in pharmaceutical formulations and research. Additionally, it may exhibit properties such as antioxidant activity and potential benefits in metabolic processes. As with many biochemical substances, it is important to handle it with care, adhering to safety guidelines to avoid any adverse reactions.
Formula:C6H11NaO8
InChI:InChI=1S/C6H10O7.Na.H2O/c7-1-2(8)3(9)4(10)5(11)6(12)13;;/h1-5,8-11H,(H,12,13);;1H2/q;+1;/p-1/t2-,3+,4-,5-;;/m0../s1
InChI key:ICQRTPLATMRWJI-JLWXJWIASA-M
SMILES:C(=O)[C@@H]([C@H]([C@@H]([C@@H](C(=O)[O-])O)O)O)O.O.[Na+]
Synonyms:
  • Sodium D-glucuronate monohydrate
  • D-Glucuronic acid sodium salt monohydrate
Found 10 products.