CAS 20731-48-0
:3-bromo-4,5-dimethoxybenzoic acid
Description:
3-Bromo-4,5-dimethoxybenzoic acid is an aromatic carboxylic acid characterized by the presence of a bromine atom and two methoxy groups attached to a benzoic acid framework. The molecular structure features a benzene ring substituted at the 3-position with a bromine atom and at the 4- and 5-positions with methoxy groups. This compound is typically a white to off-white solid and is soluble in organic solvents, while its solubility in water may be limited due to the hydrophobic nature of the aromatic system. It exhibits acidic properties due to the carboxylic acid functional group, which can donate protons in solution. The presence of the bromine and methoxy substituents can influence its reactivity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit specific biological activities, which can be explored in various chemical and biological research contexts.
Formula:C9H9BrO4
InChI:InChI=1/C9H9BrO4/c1-13-7-4-5(9(11)12)3-6(10)8(7)14-2/h3-4H,1-2H3,(H,11,12)
SMILES:COc1cc(cc(c1OC)Br)C(=O)O
Synonyms:- Benzoic Acid, 3-Bromo-4,5-Dimethoxy-
- 3-BROMO-4,5-DIMETHOXYBENZOIC ACID
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Bromo-4,5-dimethoxybenzoic Acid
CAS:Formula:C9H9BrO4Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:261.07Benzoic acid, 3-bromo-4,5-dimethoxy-
CAS:Formula:C9H9BrO4Purity:98%Color and Shape:SolidMolecular weight:261.06943-Bromo-4,5-dimethoxybenzoic acid
CAS:3-Bromo-4,5-dimethoxybenzoic acidPurity:95%Molecular weight:261.07g/mol3-Bromo-4,5-dimethoxybenzoic acid
CAS:<p>3-Bromo-4,5-dimethoxybenzoic acid is an ether that is used in the synthesis of bromophenols. It can be prepared by reacting bromonaphthalene with sodium methoxide in methanol. 3-Bromo-4,5-dimethoxybenzoic acid has a methyl ether side chain. The compound is also known as bromophenol and it is a polysiphonia extract. This compound reacts with phenols to form ethers and the reaction product can then be purified by crystallization or vacuum distillation.</p>Formula:C9H9BrO4Purity:Min. 95%Molecular weight:261.07 g/mol





