CAS 20736-25-8

4-(3-hydroxypropyl)-2,6-dimethoxyphenol

Description:

4-(3-Hydroxypropyl)-2,6-dimethoxyphenol, with the CAS number 20736-25-8, is an organic compound characterized by its phenolic structure, which includes two methoxy groups and a hydroxypropyl substituent. This compound typically exhibits properties associated with phenols, such as being a weak acid due to the presence of the hydroxyl group. The methoxy groups contribute to its hydrophobic character, while the hydroxypropyl group enhances its solubility in polar solvents. It may display antioxidant properties, making it of interest in various applications, including cosmetics and pharmaceuticals. The compound's molecular structure suggests potential for interactions with biological systems, possibly influencing its reactivity and stability. Additionally, its synthesis and handling require standard laboratory safety protocols due to the potential for reactivity typical of phenolic compounds. Overall, 4-(3-hydroxypropyl)-2,6-dimethoxyphenol is a versatile compound with unique characteristics that can be leveraged in multiple fields of research and industry.

Formula: C₁₁H₁₆O₄

InChI: InChI=1/C11H16O4/c1-14-9-6-8(4-3-5-12)7-10(15-2)11(9)13/h6-7,12-13H,3-5H2,1-2H3

SMILES: COc1cc(CCCO)cc(c1O)OC

Synonyms:

• Benzenepropanol, 4-Hydroxy-3,5-Dimethoxy-

Dihydrosinapyl alcohol

CAS: 20736-25-8

Dihydrosinapyl alcohol analytical standard

Formula: C₁₁H₁₆O₄

Color and Shape: Powder

Molecular weight: 212.25

Ref: 11-6044

Benzenepropanol, 4-hydroxy-3,5-dimethoxy-

CAS: 20736-25-8

Formula: C₁₁H₁₆O₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 212.2423

Ref: IN-DA002J0N

Dihydrosinapyl alcohol

CAS: 20736-25-8

Dihydrosinapyl alcohol

Purity: ≥98%

Molecular weight: 212.24g/mol

Ref: 54-BUP06833

Dihydrosinapyl alcohol

CAS: 20736-25-8

Dihydrosinapyl alcohol (Dihydrosinapylalcohol) is a natural product from Clerodendranthus spicatus.

Formula: C₁₁H₁₆O₄

Purity: 98.92% - 99.26%

Color and Shape: Solid

Molecular weight: 212.24

Ref: TM-TN3866

3,5-Dimethoxy-4-hydroxyhydrocinnamyl alcohol

CAS: 20736-25-8

3,5-Dimethoxy-4-hydroxyhydrocinnamyl alcohol is a phenolic compound, which is a derivative of cinnamyl alcohol and known for its antioxidant properties. It is typically isolated from plant sources, especially those with rich secondary metabolite profiles such as certain herbs and spices. The compound functions by donating hydrogen atoms to free radicals, thereby neutralizing them and preventing oxidative stress on cells.

Formula: C₁₁H₁₆O₄

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 212.24 g/mol

Ref: 3D-FD67266

4-(3-Hydroxypropyl)-2,6-dimethoxyphenol

CAS: 20736-25-8

Formula: C₁₁H₁₆O₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 212.245

Ref: 10-F450433