CAS 207399-25-5
:3-isoquinolinecarboxylic acid hydrate
Description:
3-Isoquinolinecarboxylic acid hydrate is an organic compound characterized by its isoquinoline structure, which features a bicyclic aromatic system. This compound contains a carboxylic acid functional group, contributing to its acidic properties. The presence of the hydrate indicates that it exists in a form associated with water molecules, which can influence its solubility and stability. Typically, compounds like 3-isoquinolinecarboxylic acid hydrate exhibit moderate to high solubility in polar solvents due to the hydrophilic nature of the carboxylic acid group. The compound may also participate in hydrogen bonding, affecting its physical properties and reactivity. In terms of applications, derivatives of isoquinolinecarboxylic acids are often explored in medicinal chemistry for their potential biological activities, including antimicrobial and anti-inflammatory effects. The specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise values. Overall, 3-isoquinolinecarboxylic acid hydrate represents a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C10H6NO2
InChI:InChI=1/C10H7NO2/c12-10(13)9-5-7-3-1-2-4-8(7)6-11-9/h1-6H,(H,12,13)/p-1
SMILES:c1ccc2cnc(cc2c1)C(=O)[O-]
Synonyms:- Isoquinoline-3-Carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Isoquinoline-3-carboxylic acid hydrate, 99%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C10H7NO2Purity:99%Color and Shape:Crystals or powder or crystalline powder, White to pale yellowMolecular weight:173.173-Isoquinolinecarboxylic acid hydrate
CAS:Formula:C10H9NO3Purity:97%Color and Shape:SolidMolecular weight:191.1834


