CAS 207399-28-8
:5-(2-Chloro-5-nitrophenyl)-2-furancarboxylic acid
Description:
5-(2-Chloro-5-nitrophenyl)-2-furancarboxylic acid is an organic compound characterized by its unique structure, which includes a furan ring and a carboxylic acid functional group. The presence of a chloro and a nitro substituent on the phenyl ring contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests that it could participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it a valuable intermediate in synthetic organic chemistry. Additionally, the presence of both electron-withdrawing groups (the chloro and nitro groups) can influence its acidity and reactivity, potentially enhancing its utility in targeted chemical synthesis. Safety and handling precautions should be observed due to the presence of halogen and nitro groups, which may pose health risks.
Formula:C11H6ClNO5
InChI:InChI=1S/C11H6ClNO5/c12-8-2-1-6(13(16)17)5-7(8)9-3-4-10(18-9)11(14)15/h1-5H,(H,14,15)
InChI key:InChIKey=HKMQHJBYZYAYSB-UHFFFAOYSA-N
SMILES:ClC=1C(=CC(N(=O)=O)=CC1)C=2OC(C(O)=O)=CC2
Synonyms:- 5-(2-Chloro-5-nitrophenyl)-2-furancarboxylic acid
- 2-Furancarboxylic acid, 5-(2-chloro-5-nitrophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
