CAS 20747-49-3
:(-)-neomenthol
Description:
(-)-Neomenthol is a naturally occurring monoterpene alcohol, primarily derived from the essential oils of various mint species. It is characterized by its minty aroma and flavor, making it a popular ingredient in food, cosmetics, and pharmaceuticals. The compound has a chiral center, resulting in its enantiomeric form, which is responsible for its specific sensory properties. (-)-Neomenthol is typically a colorless to pale yellow liquid at room temperature, with a relatively low boiling point. It exhibits moderate solubility in water but is more soluble in organic solvents such as ethanol and ether. The substance has been studied for its potential therapeutic effects, including anti-inflammatory and analgesic properties. Additionally, (-)-neomenthol can act as a cooling agent, often used in topical formulations to provide a sensation of freshness. Its chemical structure includes a cyclohexane ring with hydroxyl and methyl groups, contributing to its unique physical and chemical properties. Overall, (-)-neomenthol is valued for its sensory attributes and potential health benefits.
Formula:C10H20O
InChI:InChI=1/C10H20O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-11H,4-6H2,1-3H3/t8-,9+,10+/m0/s1
Synonyms:- Cyclohexanol, 5-methyl-2-(1-methylethyl)-, (1R,2R,5S)-rel-
- (1R,2R,5S)-5-methyl-2-(1-methylethyl)cyclohexanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Emtricitabine Impurity 11
CAS:Formula:C10H20OColor and Shape:Pale Yellow LiquidMolecular weight:156.27Neomenthol
CAS:Controlled ProductApplications Neomenthol is an essential oil which has potential to prevent or cure stress related diseases. Inhibitory activity in such compounds may improve dimentia, onset of cancer.
References Miyazawa, M., Oreo Saiensu, 11, 463 (2011)Formula:C10H20OColor and Shape:NeatMolecular weight:156.265


