CAS 207511-07-7
:maltoheptaose hydrate
Description:
Maltoheptaose hydrate is a carbohydrate composed of seven glucose units linked by α(1→4) glycosidic bonds, making it a member of the maltooligosaccharides family. It is a white, crystalline solid that is soluble in water, reflecting its hydrophilic nature due to the presence of multiple hydroxyl groups. The hydrate form indicates that it contains water molecules in its crystalline structure, which can influence its stability and solubility. Maltoheptaose is typically derived from the enzymatic hydrolysis of starch and is often used in food and pharmaceutical applications due to its sweet taste and ability to provide energy. It can also serve as a substrate for fermentation processes. The compound is generally recognized as safe (GRAS) when used in food products. Its molecular structure allows it to participate in various biochemical reactions, making it a valuable compound in both research and industrial contexts.
Formula:C42H74O37
InChI:InChI=1/C42H72O36.H2O/c43-1-8-15(50)16(51)24(59)37(67-8)74-31-10(3-45)69-39(26(61)18(31)53)76-33-12(5-47)71-41(28(63)20(33)55)78-35-14(7-49)72-42(29(64)22(35)57)77-34-13(6-48)70-40(27(62)21(34)56)75-32-11(4-46)68-38(25(60)19(32)54)73-30-9(2-44)66-36(65)23(58)17(30)52;/h8-65H,1-7H2;1H2/t8-,9-,10-,11-,12-,13-,14-,15-,16+,17-,18-,19-,20-,21-,22-,23-,24-,25-,26-,27-,28-,29-,30-,31-,32-,33-,34-,35-,36?,37-,38-,39-,40-,41-,42-;/m1./s1
Synonyms:- α-D-glucopyranosyl-(1->4)-α-D-glucopyranosyl-(1->4)-α-D-glucopyranosyl-(1->4)-α-D-glucopyranosyl-(1->4)-α-D-glucopyranosyl-(1->4)-α-D-glucopyranosyl-(1->4)-D-glucopyranose hydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Maltoheptaose hydrate
CAS:<p>Maltoheptaose hydrate is a mixture of oligosaccharides and monosaccharides that has been shown to be effective as a biocide. Maltoheptaose hydrate has been shown to be an effective radiation absorber, with the ability to absorb microwaves and other forms of radiation. The compound also has the capacity to form hydrogen bonds, which can lead to the formation of alcohols in solution. This property makes maltoheptaose hydrate a useful recording agent for microwave radiation, as well as being able to absorb alcohols. Maltoheptaose hydrate is composed of both monomeric and monosaccharides, which are saccharides.</p>Formula:C42H74O37Purity:Min. 95%Molecular weight:1,171 g/mol
