CAS 207511-11-3

1H-Benzimidazole-5-sulfonic acid, 2,3-dihydro-2-thioxo-, sodium salt, hydrate (1:1:2)

Description:

1H-Benzimidazole-5-sulfonic acid, 2,3-dihydro-2-thioxo-, sodium salt, hydrate (1:1:2) is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing a fused benzene and imidazole ring. This compound features a sulfonic acid group, which contributes to its solubility in water and enhances its acidic properties. The presence of the thioxo group indicates that it contains a sulfur atom double-bonded to a carbon atom, which can influence its reactivity and potential applications. As a sodium salt, it is likely to be more stable and soluble compared to its acid form. The hydrate designation suggests that the compound contains water molecules in its crystalline structure, which can affect its physical properties, such as melting point and stability. This compound may have applications in pharmaceuticals, agrochemicals, or as a reagent in various chemical reactions due to its unique structural features and functional groups.

Formula: C₇H₆N₂O₃S₂·2H₂O·Na

InChI: InChI=1S/C7H6N2O3S2.Na.2H2O/c10-14(11,12)4-1-2-5-6(3-4)9-7(13)8-5;;;/h1-3H,(H2,8,9,13)(H,10,11,12);;2*1H2

InChI key: InChIKey=IQEGYAWQFBUZJI-UHFFFAOYSA-N

SMILES: S(=O)(=O)(O)C=1C=C2C(=CC1)NC(=S)N2.[Na].O

Synonyms:

• 1H-Benzimidazole-5-sulfonic acid, 2,3-dihydro-2-thioxo-, sodium salt, hydrate (1:1:2)
• 1H-Benzimidazole-5-sulfonic acid, 2,3-dihydro-2-thioxo-, monosodium salt, dihydrate

Sodium 2-Mercapto-5-benzimidazolesulfonate Dihydrate

CAS: 207511-11-3, 53918-03-9

Formula: C₇H₅N₂NaO₃S₂·2H₂O

Purity: >98.0%(HPLC)

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 288.27

Ref: 3B-M1270

2-Mercapto-5-benzimidazolesulfonic acid sodium salt dihydrate

CAS: 207511-11-3

Formula: C₇H₉N₂NaO₅S₂

Purity: %

Color and Shape: Solid

Molecular weight: 288.2765

Ref: IN-DA002J30

Sodium 2-Mercapto-1H-Benzo[d]Imidazole-5-Sulfonate Dihydrate

CAS: 207511-11-3

Sodium 2-Mercapto-1H-Benzo[d]Imidazole-5-Sulfonate Dihydrate

Purity: 98%

Molecular weight: 288.28g/mol

Ref: 54-OR1014966

2-Mercapto-5-benzimidazole sulfonic acid sodium salt dihydrate

CAS: 207511-11-3

2-Mercapto-5-benzimidazole sulfonic acid sodium salt dihydrate is a molecule that can be used in devices. It has been shown to reversibly change the morphology of a monolayer and to generate asymmetric structures. 2-Mercapto-5-benzimidazole sulfonic acid sodium salt dihydrate can be used to generate fluorescent emulsions, which are systems where the magnetic particles are suspended in an oil droplet and illuminated by light of an appropriate wavelength. The molecules that make up 2-Mercapto-5-benzimidazole sulfonic acid sodium salt dihydrate have been shown to function as acceptors for molecular orbitals, which are wave functions that describe electron distribution around the atomic nucleus. These properties make it a promising candidate for use in microscopy techniques, such as scanning tunneling microscopy (STM) or atomic force microscopy (AFM).

Formula: C₇H₅N₂NaO₃S₂·2H₂O

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 288.28 g/mol

Ref: 3D-FM34487