
CAS 207572-66-5
:1H-Pyrazino[3,2,1-jk]carbazole, 2,3,3a,4,5,6-hexahydro-8-methyl-, methanesulfonate (1:1)
Description:
1H-Pyrazino[3,2,1-jk]carbazole, 2,3,3a,4,5,6-hexahydro-8-methyl-, methanesulfonate (1:1) is a complex organic compound characterized by its unique bicyclic structure, which incorporates both pyrazine and carbazole moieties. This compound features a hexahydro structure, indicating the presence of multiple saturated carbon atoms, contributing to its stability and potential biological activity. The methanesulfonate component suggests that it is a salt or ester derived from methanesulfonic acid, which can enhance its solubility in polar solvents. The presence of the methyl group at the 8-position of the carbazole structure may influence its electronic properties and reactivity. This compound is of interest in medicinal chemistry and materials science due to its potential applications in drug development and organic electronics. Its CAS number, 207572-66-5, allows for precise identification in chemical databases, facilitating research and development efforts. Overall, the unique structural features and functional groups of this compound make it a subject of interest for further investigation in various scientific fields.
Formula:C16H22N2O3S
InChI:InChI=1S/C15H18N2.CH4O3S/c1-10-5-6-14-12(9-10)11-3-2-4-13-15(11)17(14)8-7-16-13;1-5(2,3)4/h5-6,9,13,16H,2-4,7-8H2,1H3;1H3,(H,2,3,4)
InChI key:InChIKey=PVUYTBQAVAYLDE-UHFFFAOYSA-N
SMILES:CC=1C=C2C3=C4N(C2=CC1)CCNC4CCC3.S(C)(=O)(=O)O
Synonyms:- Pirlindole mesylate
- 1H-Pyrazino[3,2,1-jk]carbazole, 2,3,3a,4,5,6-hexahydro-8-methyl-, monomethanesulfonate
- 1H-Pyrazino[3,2,1-jk]carbazole, 2,3,3a,4,5,6-hexahydro-8-methyl-, methanesulfonate (1:1)
- Phenyl Acetate Impurity 37
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Pirlindole mesylate
CAS:monoamine oxidase type A inhibitorFormula:C16H22N2O3SPurity:98%Color and Shape:SolidMolecular weight:322.42Pirlindole mesylate
CAS:Pirlindole is a reversible inhibitor of cholinesterase that is used for the treatment of infectious diseases. Pirlindole is an acetylcholine esterase inhibitor and has been shown to inhibit growth factor-induced cell proliferation in human cancer cells. It has also been shown to have antiviral activity against certain viruses such as herpes simplex virus types 1 and 2, vesicular stomatitis virus, reovirus type 3, and influenza A virus. Pirlindole has also been found to have anti-inflammatory properties because it inhibits prostaglandin synthesis.
Formula:C16H22N2O3SPurity:Min. 95%Molecular weight:322.4 g/molRef: 3D-HIA57266
Discontinued product

