CymitQuimica logo

CAS 20759-40-4

:

3-hydroxybenzenesulfonamide

Description:
3-Hydroxybenzenesulfonamide, also known as salicylamide sulfonic acid, is an organic compound characterized by the presence of a sulfonamide group (-SO2NH2) attached to a benzene ring that also features a hydroxyl group (-OH) in the meta position. This compound is typically a white to off-white solid and is soluble in water due to the polar nature of the sulfonamide and hydroxyl functional groups. It exhibits properties typical of both sulfonamides and phenolic compounds, including potential antibacterial activity and the ability to form hydrogen bonds. The presence of the hydroxyl group contributes to its acidity and reactivity, making it useful in various chemical syntheses and applications in pharmaceuticals. Additionally, 3-hydroxybenzenesulfonamide can participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions, which are valuable in organic synthesis. Its structural features also allow it to interact with biological systems, making it a compound of interest in medicinal chemistry.
Formula:C6H7NO3S
InChI:InChI=1/C6H7NO3S/c7-11(9,10)6-3-1-2-5(8)4-6/h1-4,8H,(H2,7,9,10)
InChI key:OQPPWRYNXRWUAQ-UHFFFAOYSA-N
SMILES:c1cc(cc(c1)S(=O)(=O)N)O
Synonyms:
  • Benzenesulfonamide, 3-hydroxy-
  • 3-Hydroxybenzenesulfonamide
Found 5 products.