CAS 207598-26-3
:1-methyl-1H-indol-3-yl beta-D-galactopyranoside
Description:
1-Methyl-1H-indol-3-yl beta-D-galactopyranoside is a chemical compound characterized by its structure, which includes an indole moiety and a galactopyranoside unit. This compound features a methyl group at the 1-position of the indole ring, which contributes to its unique properties. The beta-D-galactopyranoside portion indicates that it is a glycoside, where the sugar component is galactose linked through a beta-glycosidic bond. This structure can influence its solubility, reactivity, and biological activity. The compound is of interest in various fields, including medicinal chemistry and biochemistry, due to its potential interactions with biological systems. It may exhibit specific pharmacological activities, making it a subject of research in drug development. Additionally, its CAS number, 207598-26-3, allows for easy identification and reference in scientific literature and databases. Overall, the characteristics of this compound make it a valuable subject for further study in the context of its chemical behavior and potential applications.
Formula:C15H19NO6
InChI:InChI=1/C15H19NO6/c1-16-6-10(8-4-2-3-5-9(8)16)21-15-14(20)13(19)12(18)11(7-17)22-15/h2-6,11-15,17-20H,7H2,1H3/t11-,12+,13+,14-,15-/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(2R,3R,4S,5R,6S)-2-(Hydroxymethyl)-6-((1-methyl-1H-indol-3-yl)oxy)tetrahydro-2H-pyran-3,4,5-triol
CAS:Formula:C15H19NO6Molecular weight:309.3145N-Methylindolyl-β-D-galactopyranoside monohydrate
CAS:<p>N-Methylindolyl-β-D-galactopyranoside monohydrate</p>Color and Shape:SolidMolecular weight:309.31g/molN-Methylindoxyl-β-D-galactopyranoside monohydrate
CAS:<p>N-Methylindoxyl-beta-D-galactopyranoside monohydrate (MG) is a chromogenic probe that interacts with galactose residues found on glycoproteins, which are found on cell surfaces, leading to activation of cells. MG also binds specifically to the surface of lung cells and can inhibit the development of certain types of infections..</p>Formula:C15H21NO7Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:327.33 g/mol



