CAS 207606-55-1
:5-Bromo-4-chloro-3-indoxyl-beta-D-xylopyranoside
Description:
5-Bromo-4-chloro-3-indoxyl-beta-D-xylopyranoside, with the CAS number 207606-55-1, is a synthetic compound commonly used in biochemical applications, particularly as a chromogenic substrate in enzyme assays. This compound features a complex structure that includes an indoxyl moiety, which is known for its ability to produce a colored product upon enzymatic cleavage, making it useful for visualizing enzyme activity. The presence of bromine and chlorine substituents contributes to its chemical reactivity and stability. It is typically utilized in microbiological studies to detect specific enzymes, such as β-galactosidase, through colorimetric methods. The β-D-xylopyranoside part of the molecule indicates that it is a glycoside, which can be hydrolyzed by specific glycosidases. Overall, this compound is valued in research for its specificity and sensitivity in detecting enzymatic activity, aiding in various applications in molecular biology and microbiology. Proper handling and storage conditions are essential to maintain its integrity and effectiveness in experimental settings.
Formula:C13H13BrClNO5
InChI:InChI=1/C13H13BrClNO5/c14-5-1-2-6-9(10(5)15)8(3-16-6)21-13-12(19)11(18)7(17)4-20-13/h1-3,7,11-13,16-19H,4H2/t7-,11+,12-,13+/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Bromo-4-chloro-3-indolyl β-D-xylopyranoside
CAS:Formula:C13H13BrClNO5Purity:98%Molecular weight:378.60305-Bromo-4-chloro-3-indolyl β-D-xylopyranoside
CAS:5-Bromo-4-chloro-3-indolyl β-D-xylopyranosideColor and Shape:SolidMolecular weight:378.60g/mol5-Bromo-4-chloro-3-indolyl b-D-xylopyranoside
CAS:Formula:C13H13BrClNO5Purity:≥ 99.0%Color and Shape:White to pale pink or faint green-brown powderMolecular weight:378.605-Bromo-4-chloro-3-indolyl β-D-xylopyranoside
CAS:5-Bromo-4-chloro-3-indolyl b-D-xylopyranoside is an enzyme substrate. This chromogenic substrate is used for beta-D-xylosidase enzyme. In culture media, 5-Bromo-4-chloro-3-indolyl b-D-xylopyranoside is utilised for identification of bacteria such as Klebsiella and Enterobacter.
Formula:C13H13BrClNO5Purity:Min. 95%Color and Shape:PowderMolecular weight:378.6 g/mol5-Bromo-4-chloro-3-indoxyl-β-D-xylopyranoside
CAS:5-Bromo-4-chloro-3-indoxyl-beta-D-xylopyranoside is a fluorogenic substrate that can be used to measure the activity of bacterial esterases. The enzyme cleaves the xylose moiety from 5-bromo-4-chloro-3-indoxyl, yielding indoxyl as an intermediate product. This reaction can be catalyzed by esterases found in bacteria, which hydrolyze esters containing a single hydroxyl group at one end and a carboxylic acid or alcohol at the other end. Indoxyl is fluorescent and can be detected using a fluorimeter. 5BX is also chromogenic, so it can be used as an enzyme substrate for detecting beta galactosidase activity in bacteria such as Mycobacterium smegmatis or Escherichia coli. 5BX is also used to detect chemiluminesFormula:C13H13BrClNO5Molecular weight:378.61 g/molRef: 3D-B-7750
1gTo inquire5gTo inquire10gTo inquire500mgTo inquire2500mgTo inquire-Unit-ggTo inquire



