CAS 20761-71-1

1-[(2-chloroethyl)sulfanyl]-4-methylbenzene

Description:

1-[(2-chloroethyl)sulfanyl]-4-methylbenzene, also known as a thioether compound, features a benzene ring substituted with a methyl group and a 2-chloroethylthio group. This compound exhibits characteristics typical of thioethers, including moderate polarity due to the presence of sulfur, which can influence its solubility in various solvents. The chloroethyl group introduces reactivity, making it susceptible to nucleophilic substitution reactions. The presence of the chlorine atom can also enhance the compound's potential as an alkylating agent. In terms of physical properties, thioethers generally have higher boiling points compared to their corresponding ethers due to the larger size and lower electronegativity of sulfur. The compound's structure suggests it may have applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Safety considerations are important, as the chlorine atom can pose toxicity risks, and appropriate handling measures should be taken to mitigate exposure. Overall, this compound exemplifies the diverse reactivity and utility of thioether derivatives in chemical synthesis.

Formula: C₉H₁₁ClS

InChI: InChI=1/C9H11ClS/c1-8-2-4-9(5-3-8)11-7-6-10/h2-5H,6-7H2,1H3

SMILES: Cc1ccc(cc1)SCCCl

Synonyms:

• 1-[(2-Chloroethyl)Thio]-4-Methylbenzene
• Sulfide, 2-chloroethyl-p-tolyl

1-[(2-chloroethyl)sulfanyl]-4-methylbenzene

CAS: 20761-71-1

Formula: C₉H₁₁ClS

Molecular weight: 186.7016

Ref: IN-DA002J63

1-[(2-Chloroethyl)sulfanyl]-4-methylbenzene

CAS: 20761-71-1

Versatile small molecule scaffold

Formula: C₉H₁₁ClS

Purity: Min. 95%

Molecular weight: 186.7 g/mol

Ref: 3D-VAA76171