CAS 20764-61-8
:1,2,3,4,5-penta-O-acetylhex-2-ulopyranose
Description:
1,2,3,4,5-Penta-O-acetylhex-2-ulopyranose is a chemical compound that belongs to the class of carbohydrates, specifically a derivative of hexose sugars. This compound features a pyranose ring structure, which is a six-membered ring containing five carbon atoms and one oxygen atom. The "penta-O-acetyl" designation indicates that all five hydroxyl groups on the sugar are acetylated, which enhances the compound's stability and solubility in organic solvents. The acetyl groups also influence the compound's reactivity and can facilitate various chemical transformations. This substance is typically used in synthetic organic chemistry and carbohydrate chemistry for the preparation of more complex molecules. Its CAS number, 20764-61-8, provides a unique identifier for regulatory and safety information. As with many acetylated sugars, it may exhibit specific biological activities, although detailed studies would be necessary to elucidate its full range of properties and potential applications.
Formula:C16H22O11
InChI:InChI=1/C16H22O11/c1-8(17)22-7-16(27-12(5)21)15(26-11(4)20)14(25-10(3)19)13(6-23-16)24-9(2)18/h13-15H,6-7H2,1-5H3
SMILES:CC(=O)OCC1(C(C(C(CO1)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(2S,3S,4R,5R)-2-(Acetoxymethyl)tetrahydro-2H-pyran-2,3,4,5-tetrayl tetraacetate
CAS:Formula:C16H22O11Color and Shape:LiquidMolecular weight:390.33931,2,3,4,5-Penta-O-acetyl-β-D-fructopyranose
CAS:<p>1,2,3,4,5-Penta-O-acetyl-β-D-fructopyranose</p>Molecular weight:390.33928g/mol1,2,3,4,5-Penta-O-acetyl-β-D-fructose
CAS:<p>1,2,3,4,5-Penta-O-acetyl-β-D-fructose is a synthetic oligosaccharide that is modified with fluorine to produce a variety of products. This product is used in the synthesis of complex carbohydrates and has been shown to have high purity. It is used for methylation reactions and can be found in saccharides and polysaccharides. The CAS number for this compound is 20764-61-8.</p>Formula:C16H22O11Purity:Min. 95%Color and Shape:White PowderMolecular weight:390.34 g/mol



