
CAS 20770-40-5
:Sinodor
Description:
Sinodor, with the CAS number 20770-40-5, is a chemical compound primarily known for its use as a deodorizing agent. It is characterized by its ability to neutralize odors rather than merely masking them, making it effective in various applications, including personal care products, household cleaners, and industrial settings. Sinodor functions through a mechanism that involves the binding of odor-causing molecules, thereby reducing their volatility and perceptibility. The compound is typically non-toxic and environmentally friendly, which enhances its appeal for consumer products. Additionally, Sinodor is stable under a range of conditions, contributing to its effectiveness and longevity in formulations. Its compatibility with other ingredients allows for versatile use in different formulations, making it a valuable component in the development of odor control solutions. Overall, Sinodor represents a significant advancement in the field of odor management, combining efficacy with safety for both users and the environment.
Formula:C15H26O2
InChI:InChI=1S/C15H26O2/c1-12(2)7-6-8-14(5)9-10-17-15(16)11-13(3)4/h7,11,14H,6,8-10H2,1-5H3
InChI key:InChIKey=DCEUMOZSMAUPSP-UHFFFAOYSA-N
SMILES:O(C(C=C(C)C)=O)CCC(CCC=C(C)C)C
Synonyms:- Sinodor
- 2-Butenoic acid, 3-methyl-, 3,7-dimethyl-6-octen-1-yl ester
- 2-Butenoic acid, 3-methyl-, 3,7-dimethyl-6-octenyl ester
- Crotonic acid, 3-methyl-, 3,7-dimethyl-6-octenyl ester
- 6-Octen-1-ol, 3,7-dimethyl-, 3-methylcrotonate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Butenoic acid, 3-methyl-, 3,7-dimethyl-6-octen-1-yl ester
CAS:Formula:C15H26O2Molecular weight:238.3657
