CAS 20772-12-7
:1-bromo-3-phenylpropan-2-one
Description:
1-Bromo-3-phenylpropan-2-one, with the CAS number 20772-12-7, is an organic compound characterized by its structure, which includes a bromine atom, a phenyl group, and a ketone functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its reactivity due to the presence of the bromine atom, which can participate in nucleophilic substitution reactions. The ketone functional group contributes to its potential as a precursor in organic synthesis, particularly in the formation of various derivatives through reactions such as aldol condensation or reduction. Additionally, 1-bromo-3-phenylpropan-2-one may exhibit moderate solubility in organic solvents, making it useful in various chemical applications. Safety precautions should be observed when handling this compound, as it may pose health risks, including irritation to the skin and eyes, and potential toxicity if ingested or inhaled.
Formula:C9H9BrO
InChI:InChI=1/C9H9BrO/c10-7-9(11)6-8-4-2-1-3-5-8/h1-5H,6-7H2
InChI key:InChIKey=CIFGSVFCDAILNK-UHFFFAOYSA-N
SMILES:c1ccc(cc1)CC(=O)CBr
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1-Bromo-3-phenyl-2-propanone
CAS:Controlled ProductFormula:C9H9BrOColor and Shape:NeatMolecular weight:213.071

