CAS 20772-23-0
:Thymol β-D-glucopyranoside
Description:
Thymol β-D-glucopyranoside is a glycoside compound derived from thymol, which is a natural monoterpenoid phenol found in thyme oil. This compound features a β-D-glucopyranoside moiety, indicating that a glucose molecule is linked to thymol through a glycosidic bond. Thymol β-D-glucopyranoside is known for its potential biological activities, including antimicrobial and antioxidant properties, making it of interest in both pharmaceutical and food industries. It is typically a white to off-white crystalline solid and is soluble in water and organic solvents, depending on the conditions. The compound's structure allows it to interact with various biological systems, potentially influencing metabolic pathways. Its applications may extend to natural preservatives and flavoring agents, leveraging the beneficial properties of both thymol and glucose. As with many glycosides, the hydrolysis of Thymol β-D-glucopyranoside can release thymol, contributing to its bioactivity. Overall, this compound exemplifies the intersection of chemistry and biology, showcasing the significance of glycosides in natural product chemistry.
Formula:C16H24O6
InChI:InChI=1S/C16H24O6/c1-8(2)10-5-4-9(3)6-11(10)21-16-15(20)14(19)13(18)12(7-17)22-16/h4-6,8,12-20H,7H2,1-3H3/t12-,13-,14+,15-,16-/m1/s1
InChI key:InChIKey=GKQGIQVSMCHAFX-IBEHDNSVSA-N
SMILES:O(C1=C(C(C)C)C=CC(C)=C1)[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O
Synonyms:- 5-Methyl-2-(1-methylethyl)phenyl β-D-glucopyranoside
- Thymol glucoside
- Thymol-β-D-glucoside
- β-D-Glucopyranoside, 5-methyl-2-(1-methylethyl)phenyl
- Glucopyranoside, thymyl, β-D-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
β-D-Glucopyranoside, 5-methyl-2-(1-methylethyl)phenyl
CAS:Formula:C16H24O6Purity:98%Color and Shape:SolidMolecular weight:312.3582Thymol-b-D-glucopyranoside
CAS:Formula:C16H24O6Purity:≥ 98.0%Color and Shape:White crystalline powderMolecular weight:312.36Thymolglucoside
CAS:Thymolglucoside is a useful organic compound for research related to life sciences. The catalog number is T125386 and the CAS number is 20772-23-0.Formula:C16H24O6Color and Shape:SolidMolecular weight:312.362Thymol-b-D-glucopyranoside
CAS:Controlled ProductApplications Thymol-b-D-glucopyranoside (cas# 20772-23-0) is a useful research chemical.
Formula:C16H24O6Color and Shape:NeatMolecular weight:312.36Thymol-β-D-glucopyranoside
CAS:Thymol-b-D-glucopyranoside is a bactericidal agent that is resistant to encapsulation. It has been shown to be effective against animals and typhimurium in an incubated population and endogenous deaminase inhibitor strategy. The porcine activated food chemistry and abattoir experiments show that thymol-b-D-glucopyranoside has the potential to reduce populations of bacteria in the gastrointestinal tract by inhibiting protein synthesis.Formula:C16H24O6Purity:Min. 95%Color and Shape:PowderMolecular weight:312.36 g/mol




