CAS 207742-88-9

3,4,5-trihydroxybenzaldehyde monohydrate

Description:

3,4,5-Trihydroxybenzaldehyde monohydrate, also known as gallic aldehyde, is an organic compound characterized by the presence of three hydroxyl (-OH) groups and an aldehyde (-CHO) functional group attached to a benzene ring. This compound is typically found as a white to off-white crystalline solid and is soluble in water due to the hydrophilic nature of its hydroxyl groups. The monohydrate form indicates that it contains one molecule of water per molecule of the compound, which can influence its physical properties and stability. 3,4,5-Trihydroxybenzaldehyde is known for its antioxidant properties and potential applications in pharmaceuticals, cosmetics, and food preservation. Its structure allows it to participate in various chemical reactions, including oxidation and condensation, making it a valuable intermediate in organic synthesis. Additionally, the presence of multiple hydroxyl groups enhances its reactivity and ability to form hydrogen bonds, contributing to its solubility and interaction with biological systems.

Formula: C₇H₈O₅

InChI: InChI=1/C7H6O4.H2O/c8-3-4-1-5(9)7(11)6(10)2-4;/h1-3,9-11H;1H2

SMILES: c1c(cc(c(c1O)O)O)C=O.O

Synonyms:

• 3,4,5-Trihydroxybenzaldehyde Hydrate (1:1)

Benzaldehyde, 3,4,5-trihydroxy-, hydrate (1:1)

CAS: 207742-88-9

Formula: C₇H₈O₅

Purity: 97%

Color and Shape: Solid

Molecular weight: 172.1354

Ref: IN-DA002J91

3,4,5-Trihydroxybenzaldehyde hydrate

CAS: 207742-88-9

3,4,5-Trihydroxybenzaldehyde hydrate

Purity: 97%

Ref: 54-OR1038961

3,4,5-Trihydroxybenzaldehyde monohydrate

CAS: 207742-88-9

3,4,5-Trihydroxybenzaldehyde monohydrate is a chemical compound that belongs to the class of aromatic hydrocarbons. It has been shown to have a neurotoxic effect on the mouse brain and is used in the diagnosis of neurological diseases. 3,4,5-Trihydroxybenzaldehyde monohydrate is also used as an intermediate in the synthesis of other chemicals. The molecular formula for this substance is C9H7O3 and it contains three nitrogen atoms. The molecular weight is 179.06 g/mol and its sequence length is 707 amino acids long. This substance has been found to be present in humans with chronic kidney disease and insulin resistance.

Formula: C₇H₆O₄·H₂O

Purity: (%) Min. 95%

Color and Shape: Powder

Molecular weight: 172.14 g/mol

Ref: 3D-FT55233

3,4,5-Trihydroxybenzaldehyde hydrate

CAS: 207742-88-9

Formula: C₇H₈O₅

Purity: 97%

Color and Shape: Solid, White to slightly pale yellow red powder

Molecular weight: 172.136

Ref: 10-F228173

3,4,5-Trihydroxybenzaldehyde Hydrate

Controlled Product

CAS: 207742-88-9

Applications 3,4,5-TRIHYDROXYBENZALDEHYDE HYDRATE (cas# 207742-88-9) is a useful research chemical.

Formula: C₇H₆O₄·H₂O

Color and Shape: Neat

Molecular weight: 172.13

Ref: TR-T895820