CAS 20776-48-1
:2-Amino-6-bromobenzoic acid
Description:
2-Amino-6-bromobenzoic acid, with the CAS number 20776-48-1, is an aromatic amino acid derivative characterized by the presence of both an amino group (-NH2) and a carboxylic acid group (-COOH) attached to a benzene ring that also features a bromine atom at the 6-position. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to its polar functional groups. It exhibits properties typical of amino acids, including the ability to participate in acid-base reactions due to its carboxylic acid group. The bromine substituent can influence its reactivity and stability, making it useful in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. Additionally, the presence of the amino group allows for potential interactions in biological systems, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken.
Formula:C7H6BrNO2
InChI:InChI=1/C7H6BrNO2/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3H,9H2,(H,10,11)
SMILES:c1cc(c(c(c1)N)C(=O)O)Br
Synonyms:- Benzoic acid, 2-amino-6-bromo-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Amino-6-bromobenzoic acid, 97+%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C7H6BrNO2Purity:97+%Color and Shape:White to cream to brown, PowderMolecular weight:216.03Benzoic acid, 2-amino-6-bromo-
CAS:Formula:C7H6BrNO2Purity:97%Color and Shape:SolidMolecular weight:216.03202-Amino-6-bromobenzoic acid
CAS:2-Amino-6-bromobenzoic acidFormula:C7H6BrNO2Purity:98%Color and Shape: light brown to beige powderMolecular weight:216.03g/mol2-Amino-6-bromobenzoic acid
CAS:Formula:C7H6BrNO2Purity:97%Color and Shape:SolidMolecular weight:216.034



